/* 00-base.css */
/* ==========================================================================
   EVONE v2 — sistem desain "Electric Night" (wilayah Agent A)
   Komponen bersama (tanpa awalan) yang boleh dipakai semua halaman:
   Tata letak : .wrap .wrap-n .wrap-w · .sec .sec-tight .sec-alt .sec-line · .night (bagian gelap) + .grid-bg .glow.glow-a/.glow-b .mesh
                .grid.g2/.g3/.g4 · .split(.rev) .split-art
   Teks       : .eyebrow .head(.center) .lead .grad-text .muted .display
   Tombol     : .btn .btn-primary .btn-ghost .btn-light .btn-dark .btn-sm .btn-lg · .link
   Lencana    : .pill(.dot/.live) .tag .live .soon · .specs > .spec (chip spesifikasi)
   Kartu      : .card(.glass) .ico(.g) .cards(.c2/.c4) · .bento > .bx(.w2/.w3/.w4/.w6)
   Lainnya    : [data-tabs] .tabs .tab .tab-panel · .subnav · .cmp-wrap table.cmp · .steps .step · .flow · .checks
                .stat-row .stat · .marquee · .faq .faq-grid · .cta · .phero(.solo) .crumbs .points · .form .fld · .stores .store
   Energi     : svg .e-line / .e-pulse (pathLength="100") · .e-beam (garis bercahaya horizontal)
   Muncul     : .rv (+ .d1 .d2 .d3 jeda)
   ========================================================================== */
:root {
  --c1: #00d4ff; --c2: #2563eb; --c3: #1aa3ff; --volt: #a3e635; --volt-ink: #3f6212;
  --grad: linear-gradient(120deg, #00d4ff 0%, #1aa3ff 45%, #2563eb 100%);
  --grad-soft: linear-gradient(120deg, rgba(0, 212, 255, .14), rgba(37, 99, 235, .14));
  --brand: #0891d1; --brand-ink: #0369a1;
  --ink: #07142a; --ink-2: #2a3b53; --muted: #56677f; --line: #e2e8f0; --line-2: #eef2f7;
  --page: #ffffff; --canvas: #f4f7fb; --surface: #ffffff; --raised: #ffffff; --soft: #e7f6fd; --soft-2: #eef3ff;
  --night: #040b17; --night-2: #081426; --night-3: #0d1c33; --night-line: rgba(148, 197, 255, .13);
  --night-ink: #e6f0fb; --night-muted: #97abc3; --glass: rgba(14, 30, 54, .55);
  --hdr: rgba(255, 255, 255, .78); --ok: #16a34a; --warn: #d97706; --bad: #dc2626;
  --shadow-sm: 0 1px 2px rgba(7, 20, 42, .05), 0 4px 14px -8px rgba(7, 20, 42, .14);
  --shadow: 0 1px 2px rgba(7, 20, 42, .04), 0 16px 36px -18px rgba(7, 20, 42, .24);
  --shadow-lg: 0 2px 6px rgba(7, 20, 42, .05), 0 40px 80px -32px rgba(7, 20, 42, .38);
  --r-sm: 12px; --r: 18px; --r-lg: 26px; --r-xl: 36px; --hdr-h: 72px;
  --font: "Plus Jakarta Sans", ui-sans-serif, system-ui, -apple-system, "Segoe UI", sans-serif;
  --display: "Sora", var(--font);
  --mono: ui-monospace, SFMono-Regular, Menlo, Consolas, monospace;
  color-scheme: light;
}
[data-theme="dark"] {
  --brand: #38bdf8; --brand-ink: #6fd3fb; --volt-ink: #bef264;
  --ink: #e8f0fa; --ink-2: #c2cfe1; --muted: #8d9fb7; --line: #17253a; --line-2: #111e31;
  --page: #050b16; --canvas: #08111f; --surface: #0a1425; --raised: #0e1a2e; --soft: rgba(0, 212, 255, .09); --soft-2: rgba(37, 99, 235, .12);
  --night: #03080f; --night-2: #071121; --hdr: rgba(5, 11, 22, .78);
  --shadow-sm: 0 1px 2px rgba(0, 0, 0, .35); --shadow: 0 16px 36px -18px rgba(0, 0, 0, .7); --shadow-lg: 0 40px 80px -32px rgba(0, 0, 0, .8);
  color-scheme: dark;
}

/* ---------- Dasar ---------- */
*, *::before, *::after { box-sizing: border-box; }
html { -webkit-text-size-adjust: 100%; scroll-padding-top: 96px; }
html:focus-within { scroll-behavior: smooth; }
body { margin: 0; font-family: var(--font); font-size: 16px; line-height: 1.6; color: var(--ink); background: var(--page); -webkit-font-smoothing: antialiased; overflow-x: clip; }
a { color: inherit; text-decoration: none; }
img, svg { display: block; max-width: 100%; }
img { height: auto; }
h1, h2, h3, h4 { font-family: var(--display); letter-spacing: -.025em; line-height: 1.12; margin: 0; font-weight: 700; text-wrap: balance; }
p { margin: 0; text-wrap: pretty; }
ul { margin: 0; padding: 0; list-style: none; }
button { font: inherit; color: inherit; }
::selection { background: rgba(0, 212, 255, .28); }
.ic { flex: none; display: inline-block; vertical-align: middle; }
.wrap { width: 100%; max-width: 1200px; margin: 0 auto; padding: 0 24px; }
.wrap-n { max-width: 860px; }
.wrap-w { max-width: 1320px; }
.sr-only { position: absolute; width: 1px; height: 1px; overflow: hidden; clip: rect(0 0 0 0); white-space: nowrap; }
.skip { position: absolute; left: 12px; top: -60px; z-index: 100; background: var(--ink); color: var(--page); padding: 10px 14px; border-radius: 10px; font-weight: 700; }
.skip:focus { top: 12px; }
:focus-visible { outline: 3px solid var(--c1); outline-offset: 2px; border-radius: 6px; }
.grad-text { background: var(--grad); -webkit-background-clip: text; background-clip: text; color: transparent; }
.night .grad-text { background-image: linear-gradient(110deg, #5ee7ff 0%, #38bdf8 40%, #6d8dff 100%); }
.muted { color: var(--muted); }
.display { font-family: var(--display); font-size: clamp(42px, 6vw, 80px); line-height: 1.02; letter-spacing: -.04em; }
.lead { font-size: clamp(17px, 1.5vw, 19.5px); color: var(--muted); line-height: 1.65; }
.night .lead { color: var(--night-muted); }

/* ---------- Tombol & tautan ---------- */
.btn { display: inline-flex; align-items: center; justify-content: center; gap: 8px; height: 48px; padding: 0 22px; border-radius: 999px; font-weight: 700; font-size: 15px; border: 1px solid transparent; cursor: pointer; transition: transform .15s, box-shadow .2s, background .2s, border-color .2s; white-space: nowrap; }
.btn:hover { transform: translateY(-1px); }
.btn:active { transform: none; }
.btn .ic { transition: transform .15s; }
.btn:hover .ic:last-child { transform: translateX(2px); }
.btn-primary { background: var(--grad); color: #fff; box-shadow: 0 10px 26px -10px rgba(37, 99, 235, .7), inset 0 1px 0 rgba(255, 255, 255, .25); }
.btn-primary:hover { box-shadow: 0 16px 34px -10px rgba(26, 163, 255, .85), inset 0 1px 0 rgba(255, 255, 255, .25); }
.btn-ghost { background: var(--surface); color: var(--ink); border-color: var(--line); }
.btn-ghost:hover { border-color: var(--brand); }
.btn-light { background: rgba(255, 255, 255, .07); color: #fff; border-color: rgba(255, 255, 255, .2); backdrop-filter: blur(8px); -webkit-backdrop-filter: blur(8px); }
.btn-light:hover { background: rgba(255, 255, 255, .13); border-color: rgba(255, 255, 255, .34); }
.btn-dark { background: var(--night); color: #fff; }
[data-theme="dark"] .btn-dark { background: #fff; color: var(--night); }
.btn-sm { height: 40px; padding: 0 16px; font-size: 14px; }
.btn-lg { height: 56px; padding: 0 28px; font-size: 16px; }
.link { color: var(--brand-ink); font-weight: 700; display: inline-flex; align-items: center; gap: 6px; transition: gap .15s; }
.link:hover { gap: 10px; }
.night .link { color: #6fe0ff; }

/* ---------- Lencana & chip ---------- */
.pill { display: inline-flex; align-items: center; gap: 10px; padding: 6px 16px 6px 8px; border-radius: 999px; font-size: 13.5px; font-weight: 600; border: 1px solid var(--line); background: var(--surface); color: var(--ink-2); }
.night .pill { background: rgba(255, 255, 255, .04); border-color: var(--night-line); color: var(--night-ink); }
.pill .dot { width: 24px; height: 24px; border-radius: 50%; display: grid; place-items: center; background: rgba(163, 230, 53, .14); color: var(--volt); }
.live { width: 8px; height: 8px; border-radius: 50%; background: var(--volt); box-shadow: 0 0 0 0 rgba(163, 230, 53, .6); animation: live 1.8s infinite; display: inline-block; flex: none; }
@keyframes live { 70% { box-shadow: 0 0 0 9px rgba(163, 230, 53, 0); } 100% { box-shadow: 0 0 0 0 rgba(163, 230, 53, 0); } }
.tag { display: inline-flex; align-items: center; gap: 6px; font-size: 12.5px; font-weight: 700; padding: 5px 11px; border-radius: 999px; background: var(--soft); color: var(--brand-ink); width: fit-content; }
.night .tag, .dark .tag { background: rgba(0, 212, 255, .1); color: #6fe0ff; }
.soon { display: inline-flex; align-items: center; font-size: 11px; font-weight: 800; letter-spacing: .02em; padding: 3px 9px; border-radius: 999px; background: var(--volt); color: #1a2e05; }
.specs { display: flex; flex-wrap: wrap; gap: 8px; }
.spec { display: inline-flex; align-items: center; gap: 8px; height: 34px; padding: 0 14px; border-radius: 999px; border: 1px solid var(--line); background: var(--surface); font-size: 13.5px; font-weight: 600; color: var(--ink-2); white-space: nowrap; }
.spec .ic { color: var(--brand); }
.spec b { font-family: var(--display); color: var(--ink); font-weight: 700; }
.night .spec { border-color: var(--night-line); background: rgba(255, 255, 255, .035); color: var(--night-ink); }
.night .spec .ic { color: var(--c1); }
.night .spec b { color: #fff; }

/* ---------- Header ---------- */
.hdr { position: sticky; top: 0; z-index: 50; background: var(--hdr); backdrop-filter: saturate(1.6) blur(16px); -webkit-backdrop-filter: saturate(1.6) blur(16px); border-bottom: 1px solid transparent; transition: background .25s, border-color .25s; }
.hdr.scrolled { border-bottom-color: var(--line); }
.hdr-in { height: var(--hdr-h); display: flex; align-items: center; gap: 24px; }
.logo { display: flex; align-items: center; flex: none; }
.logo { color: var(--ink); }
.logo svg { height: 28px; width: auto; }
.hdr.on-night .logo, .ftr .logo { color: #fff; }
.nav { display: flex; align-items: center; gap: 2px; flex: 1; justify-content: center; }
.nav > li { position: relative; }
.nav-a { display: inline-flex; align-items: center; gap: 4px; height: 40px; padding: 0 13px; border-radius: 999px; font-weight: 600; font-size: 15px; color: var(--ink-2); background: none; border: 0; cursor: pointer; transition: color .15s, background .15s; }
.nav-a:hover, .nav > li:focus-within > .nav-a, .nav > li.open > .nav-a { color: var(--ink); background: var(--canvas); }
.nav-a[aria-current] { color: var(--ink); }
.nav-a[aria-current]::after { content: ""; position: absolute; left: 50%; bottom: 2px; width: 5px; height: 5px; margin-left: -2.5px; border-radius: 50%; background: var(--c1); box-shadow: 0 0 8px var(--c1); }
.nav-a .ic { transition: transform .2s; opacity: .7; }
.hdr-cta { display: flex; align-items: center; gap: 8px; flex: none; }
.icon-btn { width: 40px; height: 40px; border-radius: 999px; display: grid; place-items: center; border: 1px solid var(--line); background: var(--surface); color: var(--ink-2); cursor: pointer; transition: color .15s, border-color .15s, background .15s; }
.icon-btn:hover { color: var(--ink); border-color: var(--brand); }
.theme-btn .t-dark { display: none; }
[data-theme="dark"] .theme-btn .t-dark { display: block; }
[data-theme="dark"] .theme-btn .t-light { display: none; }
.menu-btn { display: none; }
.menu-btn .m-close { display: none; }
.menu-btn[aria-expanded="true"] .m-open { display: none; }
.menu-btn[aria-expanded="true"] .m-close { display: block; }
/* header di atas hero gelap: bagian pertama ditarik ke bawah header (border transparan memperlihatkan latar .night) */
.hdr[data-night] ~ main { margin-top: calc(-1 * var(--hdr-h)); }
.hdr[data-night] ~ main > .night:first-child { border-top: var(--hdr-h) solid transparent; }
.hdr.on-night { background: rgba(4, 11, 23, .35); border-bottom-color: rgba(148, 197, 255, .08); }
.hdr.on-night .nav-a { color: #c6d4e6; }
.hdr.on-night .nav-a:hover, .hdr.on-night .nav > li:focus-within > .nav-a, .hdr.on-night .nav > li.open > .nav-a, .hdr.on-night .nav-a[aria-current] { color: #fff; background: rgba(255, 255, 255, .07); }
.hdr.on-night .icon-btn { background: rgba(255, 255, 255, .05); border-color: rgba(255, 255, 255, .14); color: #d6e2f1; }
.hdr.on-night .btn-ghost { background: rgba(255, 255, 255, .05); border-color: rgba(255, 255, 255, .18); color: #fff; }

/* Mega menu */
.mega { position: absolute; top: calc(100% + 12px); left: 50%; width: 760px; transform: translate(-50%, 8px); background: var(--raised); border: 1px solid var(--line); border-radius: 24px; box-shadow: var(--shadow-lg); padding: 10px; display: grid; grid-template-columns: 1fr 236px; gap: 10px; opacity: 0; visibility: hidden; transition: opacity .18s, transform .18s, visibility .18s; }
.mega.one { width: 600px; grid-template-columns: 1fr 236px; }
.mega::before { content: ""; position: absolute; left: 0; right: 0; top: -14px; height: 14px; }
.nav > li:hover .mega, .nav > li:focus-within .mega, .nav > li.open .mega { opacity: 1; visibility: visible; transform: translate(-50%, 0); }
.nav > li:hover > .nav-a .ic, .nav > li.open > .nav-a .ic { transform: rotate(180deg); }
.mega-items { display: grid; grid-template-columns: 1fr 1fr; gap: 2px; align-content: start; }
.mega.one .mega-items { grid-template-columns: 1fr; }
.mega-items a { display: flex; gap: 13px; padding: 13px; border-radius: 16px; transition: background .15s; }
.mega-items a:hover { background: var(--canvas); }
.mega-items b { display: block; font-size: 14.5px; line-height: 1.35; }
.mega-items small { display: block; color: var(--muted); font-size: 13px; line-height: 1.45; margin-top: 3px; }
.mega .mi { width: 40px; height: 40px; border-radius: 12px; display: grid; place-items: center; background: var(--soft); color: var(--brand-ink); flex: none; transition: background .15s, color .15s; }
.mega-items a:hover .mi { background: var(--grad); color: #fff; }
.mega-side { position: relative; overflow: hidden; border-radius: 18px; padding: 20px; background: var(--night); color: var(--night-muted); display: flex; flex-direction: column; justify-content: flex-end; min-height: 200px; font-size: 13.5px; }
.mega-side::before { content: ""; position: absolute; inset: 0; background: radial-gradient(120% 90% at 100% 0%, rgba(0, 212, 255, .32), transparent 60%), radial-gradient(90% 80% at 0% 100%, rgba(37, 99, 235, .4), transparent 60%); }
.mega-side > * { position: relative; }
.mega-side svg.ms-art { position: absolute; top: 14px; right: 14px; width: 120px; height: auto; opacity: .95; }
.mega-side b { color: #fff; font-family: var(--display); font-size: 17px; line-height: 1.25; display: block; margin-bottom: 10px; letter-spacing: -.02em; }
.mega-side .link { color: #7fe6ff; font-size: 14px; }

/* Menu seluler */
.mnav { display: none; }

/* ---------- Bagian ---------- */
.sec { padding: clamp(72px, 9vw, 120px) 0; position: relative; }
.sec-tight { padding: clamp(52px, 6vw, 80px) 0; position: relative; }
.sec-alt { background: var(--canvas); }
.sec-line { border-top: 1px solid var(--line); }
.night { background: var(--night); color: var(--night-ink); position: relative; overflow: hidden; isolation: isolate; }
.night p, .night .muted { color: var(--night-muted); }
.night h1, .night h2, .night h3, .night h4 { color: #fff; }
.night > .wrap, .night > div:not(.grid-bg):not(.glow):not(.mesh) { position: relative; z-index: 1; }
.grid-bg { position: absolute; inset: 0; z-index: 0; background-image: linear-gradient(rgba(125, 211, 252, .065) 1px, transparent 1px), linear-gradient(90deg, rgba(125, 211, 252, .065) 1px, transparent 1px); background-size: 64px 64px; mask-image: radial-gradient(ellipse 75% 65% at 60% 35%, #000 25%, transparent 75%); -webkit-mask-image: radial-gradient(ellipse 75% 65% at 60% 35%, #000 25%, transparent 75%); pointer-events: none; }
.glow { position: absolute; z-index: 0; border-radius: 50%; filter: blur(90px); pointer-events: none; }
.glow-a { width: 560px; height: 560px; right: -140px; top: -200px; background: rgba(0, 212, 255, .24); }
.glow-b { width: 520px; height: 520px; left: -220px; bottom: -260px; background: rgba(37, 99, 235, .3); }
.mesh { position: absolute; inset: 0; z-index: 0; pointer-events: none; background: radial-gradient(60% 50% at 85% 10%, rgba(0, 212, 255, .16), transparent 70%), radial-gradient(50% 50% at 10% 90%, rgba(37, 99, 235, .2), transparent 70%); }
.head { max-width: 760px; margin-bottom: clamp(36px, 4.5vw, 56px); }
.head.center { margin-left: auto; margin-right: auto; text-align: center; }
.head h2, .h2 { font-size: clamp(30px, 3.9vw, 50px); letter-spacing: -.035em; line-height: 1.08; }
.head p { font-size: clamp(16.5px, 1.4vw, 18.5px); color: var(--muted); margin-top: 18px; }
.night .head p { color: var(--night-muted); }
.eyebrow { display: inline-flex; align-items: center; gap: 10px; font-size: 12.5px; font-weight: 800; letter-spacing: .12em; text-transform: uppercase; color: var(--brand-ink); margin-bottom: 16px; }
.eyebrow::before { content: ""; width: 22px; height: 2px; border-radius: 2px; background: var(--grad); box-shadow: 0 0 10px rgba(0, 212, 255, .6); }
.night .eyebrow { color: #6fe0ff; }
.grid { display: grid; gap: 20px; }
.g2 { grid-template-columns: repeat(2, minmax(0, 1fr)); }
.g3 { grid-template-columns: repeat(3, minmax(0, 1fr)); }
.g4 { grid-template-columns: repeat(4, minmax(0, 1fr)); }

/* ---------- Kartu ---------- */
.ico { width: 46px; height: 46px; border-radius: 14px; display: grid; place-items: center; background: var(--soft); color: var(--brand-ink); flex: none; }
.ico.g { background: var(--grad); color: #fff; box-shadow: 0 10px 22px -10px rgba(37, 99, 235, .8), inset 0 1px 0 rgba(255, 255, 255, .3); }
.night .ico, .dark .ico { background: rgba(0, 212, 255, .1); color: #6fe0ff; box-shadow: inset 0 0 0 1px rgba(0, 212, 255, .18); }
.cards { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; }
.cards.c2 { grid-template-columns: repeat(2, minmax(0, 1fr)); }
.cards.c4 { grid-template-columns: repeat(4, minmax(0, 1fr)); }
.card { position: relative; border-radius: var(--r); border: 1px solid var(--line); background: var(--surface); padding: 26px; transition: transform .2s, box-shadow .2s, border-color .2s; }
a.card { display: block; }
a.card:hover { transform: translateY(-3px); box-shadow: var(--shadow); border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); }
.card h3 { font-size: 18.5px; margin: 18px 0 8px; letter-spacing: -.02em; }
.card p { color: var(--muted); font-size: 15px; }
.card .link { margin-top: 16px; font-size: 14.5px; }
.night .card, .card.glass { background: linear-gradient(180deg, rgba(255, 255, 255, .055), rgba(255, 255, 255, .02)); border-color: var(--night-line); color: var(--night-ink); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); }
.night .card p, .card.glass p { color: var(--night-muted); }
.night a.card:hover { border-color: rgba(0, 212, 255, .4); box-shadow: 0 20px 50px -24px rgba(0, 212, 255, .35); }
.num { font-family: var(--display); font-weight: 700; font-size: 14px; width: 34px; height: 34px; border-radius: 50%; display: grid; place-items: center; background: var(--grad); color: #fff; flex: none; }

/* Bento */
.bento { display: grid; grid-template-columns: repeat(6, minmax(0, 1fr)); gap: 20px; }
.bx { grid-column: span 2; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); padding: 28px; display: flex; flex-direction: column; overflow: hidden; position: relative; }
.bx.w3 { grid-column: span 3; }
.bx.w4 { grid-column: span 4; }
.bx.w6 { grid-column: span 6; }
.bx h3 { font-size: 21px; margin: 16px 0 8px; letter-spacing: -.02em; }
.bx p { color: var(--muted); font-size: 15px; }
.bx .art-slot { margin-top: auto; padding-top: 22px; }
.night .bx { background: linear-gradient(180deg, rgba(255, 255, 255, .05), rgba(255, 255, 255, .015)); border-color: var(--night-line); }
.night .bx p { color: var(--night-muted); }

/* ---------- Tab ---------- */
.tabs { display: inline-flex; flex-wrap: wrap; gap: 4px; padding: 5px; border-radius: 999px; border: 1px solid var(--line); background: var(--canvas); }
.tab { height: 40px; padding: 0 18px; border-radius: 999px; border: 0; background: none; color: var(--muted); font-weight: 700; font-size: 14.5px; cursor: pointer; display: inline-flex; align-items: center; gap: 8px; transition: background .15s, color .15s, box-shadow .15s; }
.tab:hover { color: var(--ink); }
.tab[aria-selected="true"] { background: var(--surface); color: var(--ink); box-shadow: var(--shadow-sm); }
.night .tabs { background: rgba(255, 255, 255, .04); border-color: var(--night-line); }
.night .tab { color: var(--night-muted); }
.night .tab:hover { color: #fff; }
.night .tab[aria-selected="true"] { background: rgba(255, 255, 255, .1); color: #fff; box-shadow: inset 0 0 0 1px rgba(0, 212, 255, .3); }
.tab-panel[hidden] { display: none; }
.tab-panel { animation: tabin .35s ease; }
@keyframes tabin { from { opacity: 0; transform: translateY(6px); } }

/* Sub-nav lengket (halaman panjang) */
.subnav { position: sticky; top: var(--hdr-h); z-index: 40; background: var(--hdr); backdrop-filter: saturate(1.6) blur(16px); -webkit-backdrop-filter: saturate(1.6) blur(16px); border-bottom: 1px solid var(--line); }
.subnav .wrap { display: flex; gap: 4px; overflow-x: auto; scrollbar-width: none; height: 54px; align-items: center; }
.subnav .wrap::-webkit-scrollbar { display: none; }
.subnav a { flex: none; height: 36px; padding: 0 14px; border-radius: 999px; display: inline-flex; align-items: center; gap: 6px; font-size: 14px; font-weight: 600; color: var(--muted); }
.subnav a:hover { color: var(--ink); }
.subnav a.on { color: var(--ink); background: var(--canvas); box-shadow: inset 0 0 0 1px var(--line); }

/* Tabel perbandingan */
.cmp-wrap { overflow-x: auto; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); }
.cmp { width: 100%; border-collapse: collapse; font-size: 15px; min-width: 720px; }
.cmp th, .cmp td { padding: 16px 18px; text-align: left; border-bottom: 1px solid var(--line-2); vertical-align: top; }
.cmp thead th { font-family: var(--display); font-size: 15px; background: var(--canvas); color: var(--ink); position: sticky; top: 0; }
.cmp tbody th { font-weight: 600; color: var(--ink-2); width: 26%; }
.cmp td { color: var(--muted); }
.cmp tr:last-child td, .cmp tr:last-child th { border-bottom: 0; }
.cmp .yes { color: var(--ok); }
.cmp .no { color: var(--muted); opacity: .6; }
.cmp .hl { background: color-mix(in srgb, var(--c1) 6%, transparent); }

/* Langkah */
.steps { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 20px; counter-reset: s; position: relative; }
.step { position: relative; padding: 26px; border-radius: var(--r); background: var(--surface); border: 1px solid var(--line); }
.step::before { counter-increment: s; content: "0" counter(s); font-family: var(--display); font-weight: 700; font-size: 15px; color: transparent; background: var(--grad); -webkit-background-clip: text; background-clip: text; display: block; margin-bottom: 18px; letter-spacing: .04em; }
.step h3 { font-size: 18px; margin-bottom: 8px; }
.step p { color: var(--muted); font-size: 15px; }
.night .step { background: rgba(255, 255, 255, .03); border-color: var(--night-line); }
.night .step p { color: var(--night-muted); }
/* Alur horizontal dengan garis energi */
.flow { display: grid; grid-template-columns: repeat(var(--n, 4), minmax(0, 1fr)); gap: 24px; position: relative; counter-reset: f; }
.flow::before { content: ""; position: absolute; left: 22px; right: 22px; top: 22px; height: 2px; background: linear-gradient(90deg, rgba(0, 212, 255, 0), var(--c1) 12%, var(--c2) 88%, rgba(37, 99, 235, 0)); opacity: .55; }
.flow > div { position: relative; }
.flow > div::before { counter-increment: f; content: counter(f); width: 46px; height: 46px; border-radius: 50%; display: grid; place-items: center; font-family: var(--display); font-weight: 700; background: var(--page); border: 2px solid var(--c1); color: var(--brand-ink); margin-bottom: 18px; position: relative; box-shadow: 0 0 0 6px var(--page), 0 0 22px rgba(0, 212, 255, .35); }
.sec-alt .flow > div::before { background: var(--canvas); box-shadow: 0 0 0 6px var(--canvas), 0 0 22px rgba(0, 212, 255, .35); }
.night .flow > div::before { background: var(--night); color: #6fe0ff; box-shadow: 0 0 0 6px var(--night), 0 0 22px rgba(0, 212, 255, .45); }
.flow h3 { font-size: 17.5px; margin-bottom: 6px; }
.flow p { color: var(--muted); font-size: 14.5px; }
.night .flow p { color: var(--night-muted); }

/* Teks + visual */
.split { display: grid; grid-template-columns: minmax(0, 1fr) minmax(0, 1fr); gap: clamp(40px, 6vw, 80px); align-items: center; }
.split.rev .split-art { order: -1; }
.split h2 { font-size: clamp(28px, 3.4vw, 44px); letter-spacing: -.035em; }
.split .lead { margin-top: 18px; }
.split-art { position: relative; min-width: 0; }
.checks { margin-top: 26px; display: grid; gap: 14px; }
.checks li { display: flex; gap: 12px; align-items: flex-start; }
.checks li .ck { flex: none; width: 24px; height: 24px; border-radius: 50%; display: grid; place-items: center; background: var(--soft); color: var(--brand-ink); margin-top: 1px; }
.night .checks li .ck { background: rgba(0, 212, 255, .12); color: #6fe0ff; }
.checks b { display: block; }
.checks span { color: var(--muted); font-size: 15px; }
.night .checks span { color: var(--night-muted); }

/* Angka spesifikasi teknis (hanya fakta teknis nyata) */
.stat-row { display: grid; grid-template-columns: repeat(var(--n, 4), minmax(0, 1fr)); border-top: 1px solid var(--line); border-bottom: 1px solid var(--line); }
.stat { padding: 26px 22px; border-right: 1px solid var(--line); }
.stat:last-child { border-right: 0; }
.stat b { display: block; font-family: var(--display); font-size: clamp(26px, 3vw, 38px); letter-spacing: -.03em; line-height: 1.1; }
.stat span { display: block; color: var(--muted); font-size: 14px; margin-top: 6px; }
.night .stat-row, .night .stat { border-color: var(--night-line); }
.night .stat b { color: #fff; }
.night .stat span { color: var(--night-muted); }

/* Marquee chip kemampuan */
.marquee { overflow: hidden; mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); -webkit-mask-image: linear-gradient(90deg, transparent, #000 8%, #000 92%, transparent); }
.marquee-track { display: flex; gap: 10px; width: max-content; animation: marq 48s linear infinite; }
.marquee:hover .marquee-track { animation-play-state: paused; }
@keyframes marq { to { transform: translateX(-50%); } }

/* Pita gelap & logo */
.band { border-radius: var(--r-xl); padding: 72px 64px; }
.logos-row { display: flex; flex-wrap: wrap; gap: 10px; margin-top: 26px; }
.logos-row span { padding: 8px 14px; border-radius: 999px; border: 1px solid var(--night-line); font-size: 13.5px; font-weight: 600; color: var(--night-ink); background: rgba(255, 255, 255, .03); display: inline-flex; gap: 8px; align-items: center; }
.logos-row .ic { color: var(--c1); }
.ind { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 16px; }
.ind a { display: flex; align-items: center; gap: 14px; padding: 18px 20px; border-radius: 16px; border: 1px solid var(--line); background: var(--surface); font-weight: 700; transition: .2s; }
.ind a:hover { border-color: var(--brand); box-shadow: var(--shadow-sm); }
.ind a .ic:last-child { margin-left: auto; color: var(--muted); }

/* ---------- Garis energi ---------- */
.e-line { fill: none; stroke-linecap: round; stroke-dasharray: 1 8; animation: eflow 1.2s linear infinite; }
.e-pulse { fill: none; stroke-linecap: round; stroke-dasharray: 9 91; stroke-dashoffset: 100; animation: epulse 3.2s cubic-bezier(.45, 0, .55, 1) infinite; }
.e-pulse.s2 { animation-delay: -1.1s; }
.e-pulse.s3 { animation-delay: -2.2s; }
.e-node { animation: enode 2.6s ease-in-out infinite; transform-box: fill-box; transform-origin: center; }
@keyframes eflow { to { stroke-dashoffset: -18; } }
@keyframes epulse { to { stroke-dashoffset: 0; } }
@keyframes enode { 50% { opacity: .45; transform: scale(.82); } }
.e-beam { position: relative; height: 1px; background: linear-gradient(90deg, transparent, rgba(0, 212, 255, .5), rgba(37, 99, 235, .5), transparent); overflow: hidden; }
.e-beam::after { content: ""; position: absolute; top: -1px; left: -30%; width: 30%; height: 3px; border-radius: 3px; background: linear-gradient(90deg, transparent, #7fe6ff, transparent); filter: blur(1px); animation: beam 4.5s ease-in-out infinite; }
@keyframes beam { to { left: 100%; } }
.illus { display: block; width: 100%; height: auto; }

/* ---------- CTA band ---------- */
.cta { position: relative; overflow: hidden; isolation: isolate; border-radius: var(--r-xl); padding: clamp(48px, 7vw, 88px) clamp(22px, 6vw, 72px); text-align: center; background: var(--night); color: #fff; box-shadow: 0 40px 90px -40px rgba(4, 11, 23, .55); }
.cta::after { content: ""; position: absolute; inset: 0; z-index: -1; border-radius: inherit; padding: 1px; background: linear-gradient(140deg, rgba(0, 212, 255, .55), rgba(255, 255, 255, .04) 40%, rgba(37, 99, 235, .55)); -webkit-mask: linear-gradient(#000 0 0) content-box, linear-gradient(#000 0 0); -webkit-mask-composite: xor; mask-composite: exclude; }
.cta h2 { font-size: clamp(30px, 4.2vw, 54px); color: #fff; max-width: 820px; margin: 0 auto; letter-spacing: -.04em; line-height: 1.05; }
.cta p { color: var(--night-muted); max-width: 620px; margin: 18px auto 0; font-size: 18px; }
.cta .hero-cta { justify-content: center; }
.cta > * { position: relative; }
.cta > .grid-bg, .cta > .glow, .cta > .cta-art { position: absolute; z-index: -1; }
.cta-art { left: 0; right: 0; bottom: 0; width: 100%; height: 70%; opacity: .9; pointer-events: none; }
.hero-cta { display: flex; flex-wrap: wrap; gap: 12px; margin-top: 32px; }

/* ---------- FAQ ---------- */
.faq { display: grid; gap: 10px; }
.faq details { border: 1px solid var(--line); border-radius: 18px; background: var(--surface); transition: border-color .2s, box-shadow .2s; }
.faq details[open] { border-color: color-mix(in srgb, var(--brand) 35%, var(--line)); box-shadow: var(--shadow-sm); }
.faq summary { list-style: none; cursor: pointer; padding: 20px 22px; font-weight: 700; font-size: 16.5px; display: flex; justify-content: space-between; gap: 16px; align-items: center; border-radius: 18px; }
.faq summary::-webkit-details-marker { display: none; }
.faq summary .ic { transition: transform .2s; color: var(--muted); }
.faq details[open] summary .ic { transform: rotate(45deg); color: var(--brand); }
.faq details > div { padding: 0 22px 22px; color: var(--muted); max-width: 720px; }
.faq-grid { display: grid; grid-template-columns: minmax(0, 360px) minmax(0, 1fr); gap: 64px; align-items: start; }
.night .faq details { background: rgba(255, 255, 255, .03); border-color: var(--night-line); }
.night .faq details > div { color: var(--night-muted); }

/* ---------- Hero halaman dalam ---------- */
.phero { padding: clamp(56px, 7vw, 96px) 0 clamp(64px, 7vw, 104px); }
.phero-in { position: relative; display: grid; grid-template-columns: minmax(0, 1.1fr) minmax(0, .9fr); gap: 56px; align-items: center; }
.phero h1 { font-size: clamp(36px, 5vw, 62px); margin: 16px 0 20px; letter-spacing: -.04em; line-height: 1.04; }
.phero .lead { max-width: 600px; }
.phero-art { position: relative; min-width: 0; }
.phero.solo .phero-in { grid-template-columns: minmax(0, 1fr); text-align: center; }
.phero.solo h1, .phero.solo .lead { margin-left: auto; margin-right: auto; max-width: 860px; }
.phero.solo .hero-cta, .phero.solo .crumbs, .phero.solo .points { justify-content: center; }
.points { display: flex; flex-wrap: wrap; gap: 10px 22px; margin-top: 26px; }
.points li { display: flex; gap: 8px; align-items: center; font-weight: 600; font-size: 15px; color: var(--ink-2); }
.night .points li { color: var(--night-ink); }
.points .ic { color: var(--brand); }
.night .points .ic { color: var(--volt); }
.crumbs { display: flex; flex-wrap: wrap; gap: 6px; align-items: center; font-size: 13.5px; color: var(--muted); }
.crumbs a:hover { color: var(--ink); }
.crumbs .ic { opacity: .6; }
.night .crumbs { color: var(--night-muted); }
.night .crumbs a:hover { color: #fff; }
.challenge { border-left: 3px solid; border-image: var(--grad) 1; padding: 4px 0 4px 20px; }
.challenge h3 { font-size: 18px; margin-bottom: 8px; }
.challenge p { color: var(--muted); }
.related { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; }

/* ---------- Formulir & kontak ---------- */
.form { display: grid; grid-template-columns: 1fr 1fr; gap: 16px; }
.form .full { grid-column: 1 / -1; }
.fld label { display: block; font-weight: 700; font-size: 14px; margin-bottom: 6px; }
.fld input, .fld select, .fld textarea { width: 100%; font: inherit; color: var(--ink); background: var(--page); border: 1px solid var(--line); border-radius: 12px; padding: 12px 14px; transition: border-color .15s, box-shadow .15s; }
.fld textarea { min-height: 140px; resize: vertical; }
.fld input:focus, .fld select:focus, .fld textarea:focus { outline: 0; border-color: var(--brand); box-shadow: 0 0 0 4px rgba(8, 145, 209, .16); }
.form-note { font-size: 13.5px; color: var(--muted); }
.form-msg { grid-column: 1 / -1; padding: 14px 16px; border-radius: 12px; font-weight: 600; display: none; }
.form-msg.ok { display: block; background: rgba(22, 163, 74, .1); color: var(--ok); }
.form-msg.err { display: block; background: rgba(220, 38, 38, .1); color: var(--bad); }
.contact-grid { display: grid; grid-template-columns: minmax(0, .8fr) minmax(0, 1.2fr); gap: 40px; align-items: start; }
.ccard { display: flex; gap: 14px; padding: 20px; border-radius: 16px; border: 1px solid var(--line); background: var(--surface); }
.ccard b { display: block; }
.ccard a { color: var(--brand-ink); font-weight: 700; }
.ccard p { color: var(--muted); font-size: 14.5px; }
.stores { display: flex; flex-wrap: wrap; gap: 12px; margin-top: 28px; }
.store { display: inline-flex; align-items: center; gap: 12px; height: 58px; padding: 0 20px 0 16px; border-radius: 16px; background: #000; color: #fff; border: 1px solid rgba(255, 255, 255, .2); position: relative; }
a.store { transition: transform .15s, border-color .2s; }
a.store:hover { transform: translateY(-2px); border-color: rgba(255, 255, 255, .5); }
.store.is-soon { opacity: .72; }
.store small { display: block; font-size: 11px; opacity: .75; line-height: 1.1; }
.store b { display: block; font-size: 17px; line-height: 1.2; }
.store em { position: absolute; top: -9px; right: -8px; font-style: normal; font-size: 10.5px; font-weight: 800; padding: 3px 8px; border-radius: 999px; background: var(--volt); color: #1a2e05; }

/* ---------- Footer ---------- */
.ftr { position: relative; overflow: hidden; isolation: isolate; background: var(--night); color: var(--night-muted); font-size: 14.5px; }
.ftr::before { content: ""; position: absolute; z-index: -1; width: 700px; height: 400px; left: 50%; top: -260px; transform: translateX(-50%); border-radius: 50%; background: rgba(0, 170, 255, .18); filter: blur(100px); }
.ftr-top { display: grid; grid-template-columns: minmax(0, 1.8fr) repeat(4, minmax(0, 1fr)); gap: 40px; padding: 72px 0 8px; }
.ftr-about p { margin-top: 18px; max-width: 340px; }
.ftr h3 { color: #fff; font-size: 13px; font-family: var(--font); letter-spacing: .1em; text-transform: uppercase; margin-bottom: 18px; font-weight: 800; }
.ftr li + li { margin-top: 11px; }
.ftr a { transition: color .15s; }
.ftr a:hover { color: #fff; }
.ftr-contact li { display: flex; gap: 8px; align-items: flex-start; }
.ftr-contact .ic { color: #6fe0ff; margin-top: 3px; }
.ftr-bot { margin-top: 48px; padding: 24px 0 32px; border-top: 1px solid var(--night-line); display: flex; justify-content: space-between; gap: 12px 24px; flex-wrap: wrap; font-size: 13.5px; }
.ftr-bot .specs { gap: 6px; }
.ftr .spec { border-color: var(--night-line); background: rgba(255, 255, 255, .035); color: var(--night-muted); }
.ftr-bot .spec { height: 28px; font-size: 12px; padding: 0 10px; }
.news { margin-top: 26px; max-width: 380px; }
.news label { display: block; color: #fff; font-weight: 700; font-size: 14px; margin-bottom: 10px; }
.news-row { display: flex; gap: 6px; padding: 5px; border-radius: 999px; border: 1px solid var(--night-line); background: rgba(255, 255, 255, .04); }
.news-row:focus-within { border-color: rgba(0, 212, 255, .5); }
.news input { flex: 1; min-width: 0; height: 38px; border: 0; background: none; color: #fff; padding: 0 12px; font: inherit; font-size: 14px; outline: 0; }
.news input::placeholder { color: var(--night-muted); }
.news .btn { height: 38px; }
.news-msg { font-size: 13px; margin-top: 8px; min-height: 18px; color: #9fe8ff; }

/* ---------- Animasi muncul ---------- */
.rv { opacity: 0; transform: translateY(20px); transition: opacity .8s cubic-bezier(.2, .7, .2, 1), transform .8s cubic-bezier(.2, .7, .2, 1); }
.rv.in { opacity: 1; transform: none; }
.rv.d1 { transition-delay: .08s; } .rv.d2 { transition-delay: .16s; } .rv.d3 { transition-delay: .24s; }
.no-js .rv { opacity: 1; transform: none; }

@media (prefers-reduced-motion: reduce) {
  html { scroll-behavior: auto; }
  *, *::before, *::after { animation: none !important; transition: none !important; }
  .rv { opacity: 1; transform: none; }
}

/* ---------- Responsif ---------- */
@media (max-width: 1180px) {
  .nav-a { padding: 0 10px; font-size: 14.5px; }
  .hdr-cta .btn-ghost { display: none; }
}
@media (max-width: 1080px) {
  .nav { display: none; }
  .hdr-cta .hdr-app { display: none; }
  .menu-btn { display: grid; }
  .hdr-in { justify-content: space-between; }
  .mnav { display: flex; flex-direction: column; position: fixed; inset: var(--hdr-h) 0 0; background: var(--page); z-index: 49; overflow-y: auto; padding: 8px 24px 32px; transform: translateY(-8px); opacity: 0; visibility: hidden; transition: opacity .2s, transform .2s, visibility .2s; }
  .mnav.open { transform: none; opacity: 1; visibility: visible; }
  .mnav details { border-bottom: 1px solid var(--line); }
  .mnav summary, .mnav .mn-a { display: flex; justify-content: space-between; align-items: center; padding: 18px 2px; font-family: var(--display); font-weight: 700; font-size: 20px; letter-spacing: -.02em; list-style: none; cursor: pointer; }
  .mnav .mn-a { border-bottom: 1px solid var(--line); }
  .mnav summary::-webkit-details-marker { display: none; }
  .mnav summary .ic { transition: transform .2s; color: var(--muted); }
  .mnav details[open] summary .ic { transform: rotate(180deg); }
  .mnav details > div { padding: 0 0 14px; display: grid; gap: 2px; }
  .mnav details a { display: flex; gap: 12px; align-items: center; padding: 10px 8px; border-radius: 12px; }
  .mnav details a:hover { background: var(--canvas); }
  .mnav details a .mi { width: 36px; height: 36px; border-radius: 10px; display: grid; place-items: center; background: var(--soft); color: var(--brand-ink); flex: none; }
  .mnav details a b { display: block; font-size: 15px; }
  .mnav details a small { display: block; font-size: 12.5px; color: var(--muted); line-height: 1.4; }
  .mnav details a.mn-foot { color: var(--brand-ink); font-weight: 700; font-size: 14.5px; }
  .mn-cta { display: grid; gap: 10px; margin-top: 24px; }
  .mn-cta .btn { width: 100%; }
  .mn-meta { margin-top: auto; padding-top: 28px; font-size: 13.5px; color: var(--muted); }
  .hdr.on-night.menu-open { background: var(--page); }
  .hdr.on-night.menu-open .logo { color: var(--ink); }
  .hdr.on-night.menu-open .icon-btn { background: var(--surface); border-color: var(--line); color: var(--ink-2); }
  .phero-in, .split, .faq-grid, .contact-grid, .article-grid { grid-template-columns: minmax(0, 1fr); }
  .split.rev .split-art { order: 0; }
  .bento { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .bx, .bx.w3 { grid-column: span 1; }
  .bx.w4, .bx.w6 { grid-column: span 2; }
  .cards, .cards.c4, .g3, .g4, .posts, .related, .ind { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .steps { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .flow { grid-template-columns: repeat(2, minmax(0, 1fr)); row-gap: 36px; }
  .flow::before { display: none; }
  .stat-row { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .stat:nth-child(2n) { border-right: 0; }
  .stat:nth-child(-n+2) { border-bottom: 1px solid var(--line); }
  .night .stat:nth-child(-n+2) { border-bottom-color: var(--night-line); }
  .ftr-top { grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .ftr-top > .ftr-about { grid-column: 1 / -1; }
  .band { padding: 56px 32px; }
  .faq-grid { gap: 32px; }
  .toc { position: static; }
  .post.feat { grid-template-columns: 1fr; }
}
@media (max-width: 680px) {
  .wrap { padding: 0 16px; }
  .mnav { padding: 4px 16px 28px; }
  .hdr-in { gap: 12px; }
  .hdr-cta .hdr-demo { display: none; }
  .head { margin-bottom: 32px; }
  .duo, .cards, .cards.c2, .cards.c4, .g2, .g3, .g4, .posts, .related, .ind, .steps, .form { grid-template-columns: minmax(0, 1fr); }
  .bento { grid-template-columns: minmax(0, 1fr); }
  .bx, .bx.w3, .bx.w4, .bx.w6 { grid-column: span 1; }
  .bx { padding: 24px; }
  .flow { grid-template-columns: minmax(0, 1fr); }
  .tabs { border-radius: 18px; }
  .tab { padding: 0 14px; }
  .band { padding: 48px 22px; border-radius: 26px; }
  .cta { border-radius: 26px; }
  .ftr-top { grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 32px 20px; }
  .ftr-bot { flex-direction: column; }
  .stat { padding: 20px 14px; }
  .dash { grid-template-columns: 1fr; }
  .dash-side { display: none; }
  .kpis { grid-template-columns: repeat(2, 1fr); }
  .post.feat .post-b { padding: 24px; }
  .post.feat h3 { font-size: 22px; }
  .article-cover { aspect-ratio: 16 / 10; margin-bottom: 36px; }
  .prose { font-size: 16.5px; }
}

/* 10-home.css */
/* Beranda & 404 (wilayah Agent A) — kelas berawalan h- */

/* ---------- Hero ---------- */
.h-hero { padding: clamp(40px, 6vw, 80px) 0 0; }
.h-aurora { position: absolute; z-index: 0; right: -10%; top: 4%; width: 70%; height: 80%; pointer-events: none; background: conic-gradient(from 200deg at 55% 50%, rgba(0, 212, 255, 0), rgba(0, 212, 255, .22), rgba(37, 99, 235, .3), rgba(0, 212, 255, 0) 70%); filter: blur(70px); opacity: .8; animation: aurora 18s ease-in-out infinite alternate; }
@keyframes aurora { to { transform: translate(-6%, 4%) rotate(12deg); } }
.h-hero-in { display: grid; grid-template-columns: minmax(0, 1.04fr) minmax(0, 1fr); gap: 32px; align-items: center; }
.h-copy { position: relative; z-index: 2; padding: 24px 0 40px; }
.h-pill { transition: border-color .2s, background .2s; }
.h-pill:hover { border-color: rgba(0, 212, 255, .45); background: rgba(255, 255, 255, .07); }
.h-pill .ic:last-child { opacity: .6; }
.h-hero h1 { font-size: clamp(40px, 4.8vw, 68px); line-height: 1.02; letter-spacing: -.045em; margin: 26px 0 22px; }
.h-hero .lead { max-width: 560px; }
.h-note { display: flex; gap: 10px; align-items: flex-start; margin-top: 26px; font-size: 14.5px; }
.h-note .ic { color: #6fe0ff; margin-top: 3px; }
.h-note a { color: #fff; font-weight: 700; text-decoration: underline; text-decoration-color: rgba(0, 212, 255, .6); text-underline-offset: 4px; }
.h-stage { position: relative; height: 660px; }
.h-dash { position: absolute; left: 24%; top: 56px; width: 680px; max-height: 560px; overflow: hidden; border-radius: 18px; transform: perspective(2000px) rotateY(-14deg) rotateX(5deg) rotateZ(1deg); transform-origin: 0 50%; }
.h-dash::after { content: ""; position: absolute; inset: 0; border-radius: 18px; pointer-events: none; background: linear-gradient(90deg, transparent 55%, rgba(4, 11, 23, .55)); }
.h-lines { position: absolute; inset: 0; width: 100%; height: 100%; z-index: 2; pointer-events: none; }
.h-phone { position: absolute; left: 0; top: 20px; z-index: 3; transform: rotate(-3deg); filter: drop-shadow(0 30px 60px rgba(0, 0, 0, .55)); }
.h-float { position: absolute; z-index: 4; display: flex; gap: 12px; align-items: center; padding: 12px 16px 12px 12px; border-radius: 18px; background: rgba(9, 22, 40, .72); border: 1px solid rgba(148, 197, 255, .2); backdrop-filter: blur(14px); -webkit-backdrop-filter: blur(14px); color: var(--night-muted); font-size: 12.5px; line-height: 1.35; box-shadow: 0 24px 50px -20px rgba(0, 0, 0, .75); animation: bob 7s ease-in-out infinite; }
.h-float b { display: block; color: #fff; font-size: 14px; }
.h-float .fi { width: 38px; height: 38px; border-radius: 12px; display: grid; place-items: center; background: var(--grad); color: #fff; flex: none; box-shadow: 0 8px 20px -8px rgba(0, 212, 255, .8); }
.h-float.f1 { right: 4%; bottom: 40px; }
.h-float.f2 { right: -2%; top: 0; animation-delay: -3.5s; }
.h-on { display: inline-flex; align-items: center; gap: 6px; }
@keyframes bob { 50% { transform: translateY(-8px); } }
.h-specs { position: relative; z-index: 2; display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); border-top: 1px solid var(--night-line); margin-top: 8px; }
.h-specs div { padding: 26px 22px 30px; border-right: 1px solid var(--night-line); }
.h-specs div:first-child { padding-left: 0; }
.h-specs div:last-child { border-right: 0; }
.h-specs b { display: block; color: #fff; font-family: var(--display); font-size: 17px; letter-spacing: -.02em; }
.h-specs span { display: block; font-size: 14px; color: var(--night-muted); margin-top: 4px; }

/* ---------- Dua pilar ---------- */
.h-pillars { display: grid; grid-template-columns: minmax(0, 1fr) 56px minmax(0, 1fr); align-items: stretch; }
.h-pillar { position: relative; overflow: hidden; display: flex; flex-direction: column; padding: 36px; border-radius: var(--r-xl); border: 1px solid var(--line); background: var(--surface); box-shadow: var(--shadow-sm); }
.h-pillar-art { height: 200px; margin: -8px -8px 24px; border-radius: 22px; background: radial-gradient(80% 90% at 50% 100%, rgba(0, 212, 255, .12), transparent 70%), var(--canvas); display: grid; place-items: center; color: var(--ink-2); overflow: hidden; }
.h-pillar-art svg { width: 86%; max-height: 170px; }
.h-pillar h3 { font-size: clamp(26px, 2.6vw, 34px); letter-spacing: -.035em; margin: 14px 0 10px; }
.h-pillar > p { color: var(--muted); font-size: 16.5px; }
.h-ul { display: grid; gap: 12px; margin: 24px 0 30px; }
.h-ul li { display: flex; gap: 10px; align-items: flex-start; font-weight: 600; font-size: 15px; color: var(--ink-2); }
.h-ul .ic { color: var(--brand); margin-top: 3px; }
.h-pillar-cta { margin-top: auto; display: flex; flex-wrap: wrap; gap: 10px; }
.h-pillar.dark { background: var(--night); border-color: var(--night-line); color: var(--night-ink); box-shadow: 0 40px 80px -40px rgba(4, 11, 23, .6); --node-bg: #0b1a30; }
.h-pillar.dark::before { content: ""; position: absolute; right: -30%; top: -30%; width: 80%; height: 80%; border-radius: 50%; background: rgba(0, 212, 255, .16); filter: blur(80px); pointer-events: none; }
.h-pillar.dark > * { position: relative; }
.h-pillar.dark .h-pillar-art { background: radial-gradient(70% 80% at 50% 50%, rgba(0, 212, 255, .14), transparent 70%), rgba(255, 255, 255, .03); color: #c6d4e6; }
.h-pillar.dark h3 { color: #fff; }
.h-pillar.dark > p, .h-pillar.dark .h-ul li { color: var(--night-muted); }
.h-pillar.dark .h-ul li { color: #c6d4e6; }
.h-pillar.dark .h-ul .ic { color: #6fe0ff; }
.h-bridge { position: relative; display: grid; place-items: center; }
.h-bridge::before { content: ""; position: absolute; left: -8px; right: -8px; top: 50%; height: 2px; background: var(--grad); box-shadow: 0 0 14px rgba(0, 212, 255, .7); }
.h-bridge span { position: relative; width: 44px; height: 44px; border-radius: 50%; display: grid; place-items: center; background: var(--page); border: 2px solid var(--c1); color: var(--brand-ink); box-shadow: 0 0 0 6px var(--page), 0 0 24px rgba(0, 212, 255, .45); }
.h-bridge-note { display: flex; gap: 10px; align-items: flex-start; justify-content: center; max-width: 760px; margin: 32px auto 0; text-align: left; color: var(--muted); font-size: 15px; }
.h-bridge-note .ic { color: var(--brand); margin-top: 3px; }
.h-bridge-note b { color: var(--ink); }

/* ---------- Kepala bagian dengan tombol di kanan ---------- */
.h-split-head { display: flex; justify-content: space-between; align-items: flex-end; gap: 24px; margin-bottom: clamp(36px, 4.5vw, 56px); }
.h-split-head .head { margin-bottom: 0; }
.h-split-cta { flex: none; }

/* ---------- Pengemudi (tab) ---------- */
.h-tabs .tabs { margin-bottom: 24px; }
.h-tp { display: grid; grid-template-columns: minmax(0, 1fr) minmax(0, 1fr); gap: 48px; align-items: stretch; border-radius: var(--r-xl); border: 1px solid var(--line); background: var(--surface); overflow: hidden; box-shadow: var(--shadow-sm); }
.h-tp-text { padding: clamp(28px, 4.5vw, 56px); align-self: center; }
.h-tp-text h3 { font-size: clamp(24px, 2.6vw, 34px); letter-spacing: -.035em; }
.h-tp-text > p { color: var(--muted); font-size: 16.5px; margin-top: 14px; }
.h-tp-text .link { margin-top: 28px; }
.h-tp-art { position: relative; height: 500px; overflow: hidden; padding-top: 44px; background: radial-gradient(60% 70% at 50% 100%, rgba(0, 212, 255, .2), transparent 70%), linear-gradient(180deg, var(--canvas), var(--soft-2)); mask-image: linear-gradient(#000 82%, transparent); -webkit-mask-image: linear-gradient(#000 82%, transparent); }
.h-tp-art::before { content: ""; position: absolute; left: 50%; top: 40%; width: 340px; height: 340px; margin-left: -170px; border-radius: 50%; border: 1px dashed color-mix(in srgb, var(--brand) 35%, transparent); }
.h-tp-art .phone { position: relative; }
.h-soon { display: flex; gap: 16px 20px; align-items: center; flex-wrap: wrap; margin-top: 20px; padding: 18px 22px; border-radius: var(--r); border: 1px dashed color-mix(in srgb, var(--volt) 60%, var(--line)); background: color-mix(in srgb, var(--volt) 6%, var(--surface)); }
.h-soon p { flex: 1; min-width: 240px; color: var(--muted); font-size: 15px; }
.h-soon b { color: var(--ink); }

/* ---------- Bisnis (bento segmen) ---------- */
.h-segc { transition: transform .2s, box-shadow .2s, border-color .2s; }
.h-segc:hover { transform: translateY(-4px); box-shadow: var(--shadow); border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); }
.h-seg-art { height: 176px; border-radius: 18px; margin: -6px -6px 6px; display: grid; place-items: center; color: var(--ink-2); background: radial-gradient(70% 80% at 50% 100%, rgba(0, 212, 255, .12), transparent 70%), var(--canvas); overflow: hidden; }
.h-seg-art svg { width: auto; height: 150px; max-width: 92%; }
.h-segc .link { margin-top: auto; padding-top: 18px; font-size: 14.5px; }
.h-segc:hover .link { gap: 10px; }

/* ---------- Platform ---------- */
.h-plat .split { align-items: center; }
.h-plat .split-art { min-width: 0; }
.h-plat-cards { margin-top: clamp(48px, 6vw, 80px); }
.h-plat .marquee { margin-top: 28px; }

/* ---------- Teknologi ---------- */
.h-stats { margin: 4px 0 8px; }
.h-stats .stat:nth-child(2n) { border-right: 0; }
.h-stats .stat:nth-child(-n+2) { border-bottom: 1px solid var(--line); }
.h-stats .stat { padding-left: 0; }
.h-stats .stat:nth-child(2n) { padding-left: 22px; }
.h-stats .stat b { font-size: clamp(22px, 2.4vw, 30px); }
.h-code-flow { margin-top: 28px; padding: 22px 12px 14px; border-radius: var(--r-lg); background: var(--night); color: #c6d4e6; --node-bg: #0b1a30; }

/* ---------- Kemitraan ---------- */
.h-pc h3 { font-size: 19px; }
.h-flow { margin-top: clamp(48px, 6vw, 72px); }
.h-center { text-align: center; margin-top: 48px; }

/* ---------- Blog ---------- */
.h-posts { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 24px; }
.h-post { display: flex; flex-direction: column; border-radius: var(--r-lg); overflow: hidden; border: 1px solid var(--line); background: var(--surface); transition: transform .2s, box-shadow .2s; }
.h-post:hover { transform: translateY(-4px); box-shadow: var(--shadow); }
.h-cover { aspect-ratio: 1200 / 630; overflow: hidden; background: radial-gradient(90% 120% at 100% 0%, rgba(0, 212, 255, .35), transparent 60%), radial-gradient(80% 100% at 0% 100%, rgba(37, 99, 235, .45), transparent 60%), var(--night); position: relative; }
.h-cover img { width: 100%; height: 100%; object-fit: cover; transition: transform .5s; }
.h-post:hover .h-cover img { transform: scale(1.04); }
.h-cover-fb, .h-cover-fb svg { position: absolute; inset: 0; width: 100%; height: 100%; }
.h-post-b { padding: 22px 24px 26px; display: flex; flex-direction: column; gap: 10px; }
.h-meta { display: flex; flex-wrap: wrap; gap: 8px 12px; align-items: center; font-size: 13px; color: var(--muted); }
.h-post h3 { font-size: 19px; line-height: 1.3; letter-spacing: -.02em; }
.h-post p { color: var(--muted); font-size: 15px; display: -webkit-box; -webkit-line-clamp: 2; -webkit-box-orient: vertical; overflow: hidden; }

/* ---------- 404 ---------- */
.h-404 { padding: clamp(48px, 7vw, 96px) 0 clamp(72px, 9vw, 120px); min-height: calc(100vh - var(--hdr-h)); display: flex; align-items: center; }
.h-404-in { text-align: center; }
.h-404-art { max-width: 600px; margin: 0 auto 28px; color: #c6d4e6; }
.h-404 h1 { font-size: clamp(40px, 6vw, 72px); letter-spacing: -.045em; margin-bottom: 18px; }
.h-404 .lead { max-width: 620px; margin: 0 auto; }
.h-404-go { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 14px; margin: 44px auto 0; max-width: 1040px; text-align: left; }
.h-404-go .card { display: flex; gap: 14px; align-items: center; padding: 18px; }
.h-404-go .card b { display: block; color: #fff; font-size: 15px; }
.h-404-go .card small { display: block; color: var(--night-muted); font-size: 13px; }
.h-404-go .card > .ic { margin-left: auto; color: #6fe0ff; }
.h-404-go .ico { width: 40px; height: 40px; border-radius: 12px; }
.h-404-help { margin-top: 28px; font-size: 15px; }
.h-404-help a { color: #fff; font-weight: 700; text-decoration: underline; text-underline-offset: 4px; }

/* ---------- Responsif ---------- */
@media (max-width: 1080px) {
  .h-hero-in { grid-template-columns: minmax(0, 1fr); gap: 0; }
  .h-copy { padding-bottom: 8px; }
  .h-stage { height: 640px; max-width: 640px; width: 100%; margin: 0 auto; }
  .h-dash { left: 30%; width: 600px; }
  .h-specs { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .h-specs div:nth-child(2) { border-right: 0; }
  .h-specs div:nth-child(-n+2) { border-bottom: 1px solid var(--night-line); }
  .h-specs div:nth-child(3) { padding-left: 0; }
  .h-pillars { grid-template-columns: minmax(0, 1fr); }
  .h-bridge { height: 56px; }
  .h-bridge::before { left: 50%; right: auto; top: -8px; bottom: -8px; width: 2px; height: auto; }
  .h-tp { grid-template-columns: minmax(0, 1fr); gap: 0; }
  .h-tp-text { padding-bottom: 8px; }
  .h-posts { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .h-posts .h-post:nth-child(3) { display: none; }
  .h-404-go { grid-template-columns: repeat(2, minmax(0, 1fr)); }
}
@media (max-width: 680px) {
  .h-hero h1 { font-size: clamp(36px, 10vw, 46px); }
  .h-hero .btn-lg { height: 52px; padding: 0 20px; font-size: 15px; }
  .h-stage { height: 560px; }
  .h-phone { left: 50%; top: 24px; transform: translateX(-62%) rotate(-3deg) scale(.86); transform-origin: top center; }
  .h-dash { left: 30%; top: 84px; width: 640px; max-height: 400px; -webkit-mask-image: linear-gradient(#000 70%, transparent); mask-image: linear-gradient(#000 70%, transparent); }
  .h-plat-cards { grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 12px; }
  .h-plat-cards .card { padding: 18px; }
  .h-plat-cards .card h3 { font-size: 16px; margin-top: 14px; }
  .h-plat-cards .card p { font-size: 13.5px; }
  .h-plat-cards .ico { width: 40px; height: 40px; }
  .h-code-flow { display: none; }
  .h-float { font-size: 11.5px; padding: 10px 12px 10px 10px; }
  .h-float b { font-size: 13px; }
  .h-float .fi { width: 32px; height: 32px; }
  .h-float.f1 { right: 0; bottom: 30px; }
  .h-float.f2 { right: 0; top: 4px; }
  .h-lines { display: none; }
  .h-specs div { padding: 18px 12px 20px 0; }
  .h-specs div:nth-child(2n) { padding-left: 14px; }
  .h-specs b { font-size: 15px; }
  .h-specs span { font-size: 12.5px; }
  .h-pillar { padding: 24px; border-radius: 26px; }
  .h-pillar-art { height: 160px; }
  .h-split-head { flex-direction: column; align-items: flex-start; }
  .h-tabs .tabs { display: flex; flex-wrap: nowrap; overflow-x: auto; scrollbar-width: none; border-radius: 999px; max-width: 100%; }
  .h-tabs .tabs::-webkit-scrollbar { display: none; }
  .h-tabs .tab { flex: none; }
  .h-tp-art { height: 440px; }
  .h-seg-art { height: 150px; }
  .h-seg-art svg { height: 128px; }
  .h-posts { grid-template-columns: minmax(0, 1fr); }
  .h-posts .h-post:nth-child(3) { display: flex; }
  .h-404-go { grid-template-columns: minmax(0, 1fr); }
  .h-stats .stat:nth-child(2n) { padding-left: 14px; }
}
.h-pillar.dark .h-pillar-art svg { width: auto; height: 196px; max-height: none; }

/* 15-mock-app.css */
/* Mockup aplikasi pengemudi (wilayah Agent C) — awalan ma-. Layar ikut tema lewat token --m-*. */
.phone {
  --m-bg: #f3f6fb; --m-card: #ffffff; --m-ink: #0a1a2f; --m-mut: #5f6f86; --m-line: #e3eaf3; --m-soft: #e6f6fd; --m-soft-ink: #0369a1;
  --m-map: #e6eef6; --m-road: #ffffff; --m-park: #d5efdd; --m-water: #cfe6fb; --m-hw: #fde68a;
  width: 280px; max-width: 100%; margin: 0 auto; border-radius: 46px; padding: 10px; position: relative; flex: none;
  background: linear-gradient(155deg, #26354d, #0a1220 55%, #141f33);
  box-shadow: 0 50px 90px -34px rgba(2, 8, 20, .75), 0 0 0 1px rgba(255, 255, 255, .06), inset 0 0 0 1.5px rgba(255, 255, 255, .1);
}
[data-theme="dark"] .phone, .phone.ma-dark {
  --m-bg: #060e1b; --m-card: #0d1a2d; --m-ink: #e8f0fa; --m-mut: #8ea2bb; --m-line: #1a2a42; --m-soft: rgba(0, 212, 255, .12); --m-soft-ink: #67e8f9;
  --m-map: #0b1626; --m-road: #172840; --m-park: #0f2a24; --m-water: #0d2340; --m-hw: #3b3417;
}
[data-theme="dark"] .phone { box-shadow: 0 50px 90px -34px rgba(0, 0, 0, .9), 0 0 0 1px rgba(148, 197, 255, .2), inset 0 0 0 1.5px rgba(255, 255, 255, .12); }
.phone::before { content: ""; position: absolute; top: 19px; left: 50%; transform: translateX(-50%); width: 82px; height: 24px; border-radius: 20px; background: #03070d; z-index: 3; }
.phone::after { content: ""; position: absolute; inset: 0; border-radius: inherit; pointer-events: none; background: linear-gradient(115deg, rgba(255, 255, 255, .1), transparent 28%); }
.scr { border-radius: 37px; overflow: hidden; background: var(--m-bg); color: var(--m-ink); height: 580px; position: relative; font-size: 12px; line-height: 1.4; font-family: var(--font); text-align: left; }
.scr b { font-weight: 700; }
.ma-ribbon { position: absolute; z-index: 4; top: -12px; right: 18px; padding: 5px 11px; border-radius: 999px; background: var(--volt); color: #1a2e05; font-size: 11px; font-weight: 800; letter-spacing: .02em; box-shadow: 0 8px 18px -8px rgba(0, 0, 0, .6); }
.ma-bar { height: 46px; display: flex; justify-content: space-between; align-items: center; padding: 8px 28px 0; font-weight: 700; font-size: 11.5px; }
.ma-bar-r { display: flex; gap: 4px; align-items: center; }
.ma-pad { padding: 4px 16px 16px; }
.scr h4 { font-family: var(--display); font-size: 17px; letter-spacing: -.02em; color: var(--m-ink); margin: 0; }
.ma-sm { font-size: 11px; color: var(--m-mut); display: block; }
.ma-head { display: flex; justify-content: space-between; align-items: center; gap: 8px; margin-bottom: 12px; }
.ma-fab, .ma-x { width: 32px; height: 32px; border-radius: 11px; display: grid; place-items: center; background: var(--grad); color: #fff; box-shadow: 0 8px 16px -8px rgba(37, 99, 235, .8); flex: none; }
.ma-x { background: var(--m-card); color: var(--m-mut); box-shadow: inset 0 0 0 1px var(--m-line); }
.ma-card { background: var(--m-card); border: 1px solid var(--m-line); border-radius: 15px; padding: 12px; margin-bottom: 10px; }
.ma-flex { display: flex; justify-content: space-between; align-items: center; gap: 8px; }
.ma-mini { padding: 9px 12px; justify-content: flex-start; }
.ma-big { font-family: var(--display); font-size: 16px; display: block; }
.ma-cap { margin: 4px 2px 8px; font-weight: 600; }
.ma-grow { flex: 1; min-width: 0; }
.ma-chip { display: inline-flex; align-items: center; gap: 4px; padding: 4px 9px; border-radius: 999px; font-size: 10.5px; font-weight: 700; background: var(--m-soft); color: var(--m-soft-ink); white-space: nowrap; }
.ma-chip.on { background: var(--m-ink); color: var(--m-bg); }
.ma-chip.ok { background: rgba(22, 163, 74, .12); color: #15803d; }
[data-theme="dark"] .ma-chip.ok, .ma-dark .ma-chip.ok { color: #86efac; background: rgba(34, 197, 94, .14); }
.ma-chip.live { background: rgba(163, 230, 53, .18); color: #3f6212; }
[data-theme="dark"] .ma-chip.live { color: var(--volt); }
.ma-chip .live { width: 6px; height: 6px; }
/* Baris daftar */
.ma-list { padding: 4px 12px; }
.ma-row { display: flex; align-items: center; gap: 10px; padding: 9px 0; border-bottom: 1px solid var(--m-line); }
.ma-row:last-child { border-bottom: 0; }
.ma-tight .ma-row { padding: 7px 0; }
.ma-row b { display: block; font-size: 12px; white-space: nowrap; overflow: hidden; text-overflow: ellipsis; }
.ma-amt { flex: none; font-size: 12px; }
.ma-amt.plus { color: #15803d; }
[data-theme="dark"] .ma-amt.plus { color: #86efac; }
.ma-ri { width: 30px; height: 30px; border-radius: 10px; display: grid; place-items: center; flex: none; background: var(--m-soft); color: var(--m-soft-ink); }
.ma-ri.am { background: rgba(245, 158, 11, .14); color: #b45309; }
.ma-ri.gr { background: rgba(22, 163, 74, .12); color: #15803d; }
.ma-ri.rd { background: rgba(239, 68, 68, .12); color: #b91c1c; }
[data-theme="dark"] .ma-ri.am { color: #fbbf24; } [data-theme="dark"] .ma-ri.gr { color: #86efac; } [data-theme="dark"] .ma-ri.rd { color: #fca5a5; }
/* Ringkasan Catatan EV */
.ma-sum { border-radius: 18px; padding: 14px; color: #fff; margin-bottom: 10px; background: radial-gradient(120% 140% at 100% 0%, #22d3ee 0%, #2563eb 55%, #1e3a8a 100%); box-shadow: 0 16px 30px -18px rgba(37, 99, 235, .9); }
.ma-sum .ma-sm { color: rgba(255, 255, 255, .8); }
.ma-sum > div > b { font-family: var(--display); font-size: 22px; display: block; margin: 2px 0 10px; letter-spacing: -.02em; }
.ma-sum-g { display: grid; grid-template-columns: repeat(3, 1fr); gap: 6px; }
.ma-sum-g div { background: rgba(255, 255, 255, .14); border-radius: 10px; padding: 6px 8px; }
.ma-sum-g i { font-style: normal; font-size: 10px; opacity: .8; display: block; }
.ma-sum-g b { font-size: 12px; }
.ma-filters { display: flex; gap: 6px; margin-bottom: 10px; overflow: hidden; }
.ma-remind { display: flex; gap: 10px; align-items: center; }
.ma-remind b { display: block; }
.ma-tabbar { position: absolute; left: 0; right: 0; bottom: 0; height: 62px; display: grid; grid-template-columns: repeat(4, 1fr); background: var(--m-card); border-top: 1px solid var(--m-line); padding: 8px 6px 12px; }
.ma-tabbar span { display: grid; justify-items: center; gap: 2px; color: var(--m-mut); font-size: 9.5px; font-weight: 600; }
.ma-tabbar i { font-style: normal; }
.ma-tabbar .on { color: var(--m-soft-ink); }
/* Formulir */
.ma-seg { display: grid; grid-template-columns: repeat(4, 1fr); gap: 3px; padding: 3px; border-radius: 12px; background: var(--m-card); border: 1px solid var(--m-line); margin-bottom: 10px; }
.ma-seg span { text-align: center; padding: 6px 0; border-radius: 9px; font-weight: 700; font-size: 10.5px; color: var(--m-mut); }
.ma-seg .on { background: var(--grad); color: #fff; }
.ma-form { display: grid; gap: 8px; }
.ma-2 { display: grid; grid-template-columns: 1fr 1fr; gap: 8px; }
.ma-2b { display: grid; grid-template-columns: 1fr 1.4fr; gap: 8px; }
.ma-fld { border: 1px solid var(--m-line); border-radius: 11px; padding: 7px 10px; background: var(--m-bg); }
.ma-fld b { font-size: 12.5px; display: block; }
.ma-attach { display: flex; gap: 10px; align-items: center; }
.ma-attach b { display: block; }
.ma-thumb { width: 38px; height: 38px; border-radius: 9px; display: grid; place-items: center; background: repeating-linear-gradient(0deg, var(--m-line) 0 2px, var(--m-card) 2px 6px); color: var(--m-mut); border: 1px solid var(--m-line); }
.ma-btn { height: 40px; border-radius: 12px; display: flex; align-items: center; justify-content: center; gap: 6px; font-weight: 700; color: #fff; background: var(--grad); font-size: 12.5px; box-shadow: 0 10px 20px -12px rgba(37, 99, 235, .9); }
.ma-btn.ghost { background: var(--m-card); color: var(--m-ink); border: 1px solid var(--m-line); box-shadow: none; }
.ma-btn.red { background: #ef4444; box-shadow: none; }
/* Baterai */
.ma-soh { display: flex; justify-content: space-between; align-items: center; gap: 12px; }
.ma-soh b { font-family: var(--display); font-size: 30px; display: block; letter-spacing: -.03em; line-height: 1.1; }
.ma-batt { width: 70px; height: 34px; border-radius: 8px; border: 2px solid var(--m-ink); padding: 3px; position: relative; flex: none; }
.ma-batt::after { content: ""; position: absolute; right: -6px; top: 10px; width: 4px; height: 10px; border-radius: 0 3px 3px 0; background: var(--m-ink); }
.ma-batt i { display: block; height: 100%; border-radius: 4px; background: linear-gradient(90deg, #00d4ff, #a3e635); }
.ma-spark { height: 64px; display: flex; align-items: flex-end; gap: 5px; }
.ma-spark i { flex: 1; border-radius: 4px 4px 2px 2px; background: linear-gradient(180deg, #00d4ff, #2563eb); opacity: .85; min-height: 6px; }
/* Peta */
.ma-map { position: relative; height: 350px; background: var(--m-map); overflow: hidden; }
.ma-mapsvg { position: absolute; inset: 0; width: 100%; height: 100%; }
.ma-mapsvg .mb, .ma-route .mb { fill: var(--m-map); }
.ma-mapsvg .mr, .ma-route .mr { stroke: var(--m-road); fill: none; }
.ma-mapsvg .mh { stroke: var(--m-hw); }
.ma-mapsvg .mp { fill: var(--m-park); }
.ma-mapsvg .mw { fill: var(--m-water); }
.ma-pin { position: absolute; transform: translate(-50%, -100%); width: 34px; height: 34px; border-radius: 50% 50% 50% 6px; rotate: -45deg; display: grid; place-items: center; background: var(--grad); box-shadow: 0 8px 16px -6px rgba(37, 99, 235, .8); }
.ma-pin b { rotate: 45deg; color: #fff; font-size: 9.5px; font-weight: 800; }
.ma-pin.ac { background: linear-gradient(135deg, #0ea5e9, #0369a1); }
.ma-me { position: absolute; width: 16px; height: 16px; border-radius: 50%; background: #2563eb; border: 3px solid #fff; transform: translate(-50%, -50%); box-shadow: 0 0 0 9px rgba(37, 99, 235, .2); }
.ma-search { position: absolute; left: 12px; right: 12px; top: 6px; background: var(--m-card); border-radius: 13px; padding: 9px 12px; display: flex; gap: 8px; align-items: center; color: var(--m-mut); box-shadow: 0 8px 18px -10px rgba(10, 26, 47, .4); }
.ma-search span:first-of-type { flex: 1; }
.ma-filt { color: var(--m-soft-ink); }
.ma-mchips { position: absolute; left: 12px; right: 12px; top: 52px; display: flex; gap: 6px; }
.ma-mchips .ma-chip:not(.on) { background: var(--m-card); color: var(--m-ink); box-shadow: 0 4px 10px -6px rgba(10, 26, 47, .4); }
.ma-sheet { position: absolute; left: 0; right: 0; bottom: 0; background: var(--m-card); border-radius: 22px 22px 0 0; padding: 12px 16px 18px; box-shadow: 0 -12px 30px -14px rgba(10, 26, 47, .45); }
.ma-sheet::before { content: ""; display: block; width: 36px; height: 4px; border-radius: 4px; background: var(--m-line); margin: 0 auto 10px; }
.ma-sheet h4 { font-size: 15px; }
.ma-conns { display: grid; grid-template-columns: 1fr 1fr; gap: 8px; margin-bottom: 10px; }
.ma-conns span { border: 1px solid var(--m-line); border-radius: 11px; padding: 7px 10px; }
.ma-conns b { display: block; font-size: 12.5px; }
.ma-conns i { font-style: normal; font-size: 10.5px; color: var(--m-mut); }
/* Perjalanan */
.ma-route { padding: 0; overflow: hidden; }
.ma-route svg { width: 100%; height: 132px; display: block; }
.ma-stats { display: grid; grid-template-columns: repeat(3, 1fr); gap: 6px; margin-bottom: 10px; }
.ma-stats div { background: var(--m-card); border: 1px solid var(--m-line); border-radius: 12px; padding: 7px 4px; text-align: center; }
.ma-stats i { font-style: normal; font-size: 10px; color: var(--m-mut); display: block; }
.ma-stats b { font-size: 12.5px; }
.ma-wear { display: grid; grid-template-columns: 62px 1fr 32px; gap: 8px; align-items: center; padding: 3px 0; font-size: 11px; }
.ma-wear span:first-child { display: flex; gap: 4px; align-items: center; color: var(--m-mut); }
.ma-wear b { text-align: right; font-size: 11px; }
.ma-meter { height: 6px; border-radius: 6px; background: var(--m-line); overflow: hidden; }
.ma-meter i { display: block; height: 100%; border-radius: 6px; }
.ma-meter .ok { background: linear-gradient(90deg, #00d4ff, #22c55e); }
.ma-meter .warn { background: linear-gradient(90deg, #fbbf24, #f97316); }
/* Speed run */
.ma-speed b { font-family: var(--display); font-size: 40px; letter-spacing: -.04em; display: block; line-height: 1.1; }
.ma-speed b small { font-size: 14px; margin-left: 4px; color: var(--m-mut); }
.ma-speed .ma-2 b { font-size: 15px; font-family: var(--font); letter-spacing: 0; }
.ma-speed-line { height: 6px; border-radius: 6px; background: var(--m-line); margin: 10px 0 12px; overflow: hidden; }
.ma-speed-line i { display: block; width: 78%; height: 100%; background: linear-gradient(90deg, #a3e635, #00d4ff, #2563eb); }
.ma-note { display: flex; gap: 8px; color: var(--m-mut); font-size: 11px; align-items: flex-start; }
/* My EV */
.ma-ev { display: flex; flex-direction: column; gap: 6px; border-radius: 18px; padding: 12px 14px; margin-bottom: 10px; color: var(--m-ink); background: linear-gradient(160deg, var(--m-soft), var(--m-card)); border: 1px solid var(--m-line); }
.ma-ev svg { width: 100%; height: 70px; color: var(--m-soft-ink); }
.ma-ev b { font-size: 14px; display: block; }
.ma-specs { display: grid; grid-template-columns: repeat(4, 1fr); gap: 4px; padding: 10px 8px; text-align: center; }
.ma-specs i { font-style: normal; font-size: 9.5px; color: var(--m-mut); display: block; }
.ma-specs b { font-size: 11.5px; }
/* Masuk */
.ma-login { text-align: center; padding-top: 30px; }
.ma-logo { display: grid; place-items: center; margin-bottom: 14px; }
.ma-login h4 { font-size: 20px; }
.ma-login > p { margin: 6px 0 20px; }
.ma-phone { text-align: left; margin-bottom: 12px; }
.ma-otp { display: grid; grid-template-columns: repeat(6, 1fr); gap: 6px; margin-bottom: 14px; }
.ma-otp span { height: 40px; border-radius: 10px; border: 1px solid var(--m-line); background: var(--m-card); display: grid; place-items: center; font-family: var(--display); font-weight: 700; font-size: 16px; }
.ma-otp .cur { border-color: #00d4ff; box-shadow: 0 0 0 3px rgba(0, 212, 255, .2); }
.ma-or { display: flex; align-items: center; gap: 8px; color: var(--m-mut); font-size: 11px; margin: 12px 0; }
.ma-or::before, .ma-or::after { content: ""; flex: 1; height: 1px; background: var(--m-line); }
/* Notifikasi layar kunci */
.ma-lock { position: absolute; inset: 0; padding: 60px 12px 16px; background: radial-gradient(90% 60% at 80% 10%, rgba(0, 212, 255, .35), transparent 70%), radial-gradient(80% 60% at 0% 100%, rgba(37, 99, 235, .45), transparent 70%), #040b17; color: #fff; }
.ma-time { text-align: center; font-family: var(--display); font-size: 54px; font-weight: 600; letter-spacing: -.04em; line-height: 1; margin: 10px 0 26px; }
.ma-time span { display: block; font-family: var(--font); font-size: 12px; font-weight: 600; letter-spacing: 0; opacity: .8; margin-top: 8px; }
.ma-notif { display: flex; gap: 10px; align-items: flex-start; padding: 10px 12px; border-radius: 16px; background: rgba(255, 255, 255, .12); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); margin-bottom: 8px; border: 1px solid rgba(255, 255, 255, .1); }
.ma-notif b { display: block; font-size: 12px; }
.ma-notif span { font-size: 11px; opacity: .8; }
.ma-notif > i { font-style: normal; font-size: 10px; opacity: .6; flex: none; }
.ma-ni { width: 26px; height: 26px; border-radius: 8px; display: grid; place-items: center; background: var(--grad); flex: none; }
.ma-lock .ma-ni .ic { color: #fff; }
/* Sesi charging */
.ma-ring { position: relative; width: 168px; height: 168px; margin: 8px auto 12px; }
.ma-ring svg { width: 100%; height: 100%; transform: rotate(-90deg); }
.ma-ring-bg { stroke: var(--m-line); }
.ma-ring-in { position: absolute; inset: 0; display: grid; place-items: center; text-align: center; }
.ma-ring-in b { font-family: var(--display); font-size: 34px; line-height: 1; display: block; }
/* Scan */
.ma-scan { position: absolute; inset: 0; padding-top: 70px; background: linear-gradient(180deg, #08121f, #02060c); color: #fff; text-align: center; }
.ma-scan-t { color: rgba(255, 255, 255, .8); margin-bottom: 26px; }
.ma-qr { position: relative; width: 180px; height: 180px; margin: 0 auto; display: grid; place-items: center; color: rgba(255, 255, 255, .9); }
.ma-qr > i { position: absolute; width: 34px; height: 34px; border: 3px solid #00d4ff; }
.ma-qr > i:nth-child(1) { left: 0; top: 0; border-right: 0; border-bottom: 0; border-radius: 12px 0 0 0; }
.ma-qr > i:nth-child(2) { right: 0; top: 0; border-left: 0; border-bottom: 0; border-radius: 0 12px 0 0; }
.ma-qr > i:nth-child(3) { left: 0; bottom: 0; border-right: 0; border-top: 0; border-radius: 0 0 0 12px; }
.ma-qr > i:nth-child(4) { right: 0; bottom: 0; border-left: 0; border-top: 0; border-radius: 0 0 12px 0; }
.ma-laser { position: absolute; left: 14px; right: 14px; top: 50%; height: 2px; background: #a3e635; box-shadow: 0 0 14px #a3e635; animation: ma-scan 2.4s ease-in-out infinite; }
@keyframes ma-scan { 0%, 100% { transform: translateY(-70px); } 50% { transform: translateY(70px); } }
.ma-scan-b { position: absolute; left: 16px; right: 16px; bottom: 24px; display: grid; gap: 8px; }
.ma-scan-b span { display: flex; gap: 8px; align-items: center; justify-content: center; height: 40px; border-radius: 12px; background: rgba(255, 255, 255, .1); border: 1px solid rgba(255, 255, 255, .14); font-weight: 600; }
/* EvoPay */
.ma-wal { border-radius: 18px; padding: 14px 16px; color: #fff; background: radial-gradient(120% 140% at 100% 0%, #22d3ee 0%, #2563eb 55%, #1e3a8a 100%); margin-bottom: 10px; }
.ma-wal > span { font-size: 11px; opacity: .85; }
.ma-wal b { font-family: var(--display); font-size: 24px; display: block; margin: 2px 0 10px; }
.ma-wal div { display: flex; gap: 6px; }
.ma-wal div span { display: inline-flex; gap: 4px; align-items: center; padding: 5px 10px; border-radius: 999px; background: rgba(255, 255, 255, .18); font-size: 10.5px; font-weight: 700; }
.ma-pay { display: grid; grid-template-columns: repeat(4, 1fr); gap: 6px; margin-bottom: 10px; }
.ma-pay span { background: var(--m-card); border: 1px solid var(--m-line); border-radius: 10px; padding: 8px 0; text-align: center; font-weight: 800; font-size: 10.5px; }
/* Home charger */
.ma-home { display: flex; gap: 12px; align-items: center; color: var(--m-ink); }
.ma-home b { display: block; font-size: 13px; }
.ma-hours { display: grid; grid-template-columns: repeat(24, 1fr); gap: 2px; height: 34px; margin-top: 10px; }
.ma-hours i { border-radius: 3px; background: var(--m-line); }
.ma-hours i.on { background: linear-gradient(180deg, #00d4ff, #2563eb); }
.ma-hl { display: flex; justify-content: space-between; font-size: 9.5px; color: var(--m-mut); margin-top: 4px; }
@media (max-width: 380px) { .phone { width: 262px; } .scr { height: 556px; } }

/* 16-mock-csms.css */
/* Mockup CSMS (cs-*) — wilayah agent Bisnis & Platform. Responsif lewat container query, tajam di terang & gelap. */
.cs-browser {
  --cs-bg: var(--surface); --cs-side: var(--canvas); --cs-line: var(--line); --cs-line2: var(--line-2); --cs-sub: var(--muted);
  --cs-ok: #16a34a; --cs-okbg: rgba(22, 163, 74, .12); --cs-bad: #dc2626; --cs-badbg: rgba(220, 38, 38, .11);
  --cs-warn: #b45309; --cs-warnbg: rgba(217, 119, 6, .13); --cs-off: #64748b; --cs-offbg: rgba(100, 116, 139, .13);
  --cs-chg: #3f6212; --cs-chgbg: rgba(163, 230, 53, .28); --cs-acc: #0369a1; --cs-accbg: rgba(14, 165, 233, .12);
  container-type: inline-size; margin: 0; border-radius: 18px; overflow: hidden; background: var(--cs-bg); border: 1px solid var(--cs-line);
  box-shadow: var(--shadow-lg); font-size: 12px; line-height: 1.4; color: var(--ink); text-align: left; font-family: var(--font);
}
[data-theme="dark"] .cs-browser { --cs-ok: #4ade80; --cs-okbg: rgba(74, 222, 128, .13); --cs-bad: #f87171; --cs-badbg: rgba(248, 113, 113, .14); --cs-warn: #fbbf24; --cs-warnbg: rgba(251, 191, 36, .13); --cs-off: #94a3b8; --cs-offbg: rgba(148, 163, 184, .14); --cs-chg: #d9f99d; --cs-chgbg: rgba(163, 230, 53, .18); --cs-acc: #7dd3fc; --cs-accbg: rgba(56, 189, 248, .14); }
.night .cs-browser, .cs-browser.glow-edge { box-shadow: 0 0 0 1px rgba(125, 211, 252, .14), 0 40px 90px -30px rgba(0, 0, 0, .75), 0 0 80px -30px rgba(0, 212, 255, .35); border-color: rgba(148, 197, 255, .22); }
.cs-bar { height: 36px; display: flex; align-items: center; gap: 10px; padding: 0 12px; border-bottom: 1px solid var(--cs-line); background: var(--cs-side); }
.cs-dots { display: flex; gap: 6px; flex: none; }
.cs-dots i { width: 10px; height: 10px; border-radius: 50%; background: #f87171; }
.cs-dots i:nth-child(2) { background: #fbbf24; }
.cs-dots i:nth-child(3) { background: #34d399; }
.cs-url { flex: 1; min-width: 0; max-width: 340px; margin: 0 auto; height: 22px; border-radius: 7px; background: var(--cs-bg); border: 1px solid var(--cs-line); font-size: 11px; color: var(--cs-sub); display: flex; align-items: center; gap: 6px; padding: 0 10px; overflow: hidden; white-space: nowrap; }
.cs-url span { overflow: hidden; text-overflow: ellipsis; }
.cs-sample { flex: none; font-size: 10px; font-weight: 700; letter-spacing: .02em; padding: 3px 8px; border-radius: 999px; background: var(--cs-accbg); color: var(--cs-acc); }
.cs-app { display: grid; grid-template-columns: 168px minmax(0, 1fr); min-height: 380px; }
.cs-side { border-right: 1px solid var(--cs-line); padding: 12px 10px; display: flex; flex-direction: column; gap: 10px; background: var(--cs-side); }
.cs-brand { display: flex; align-items: center; gap: 7px; padding: 2px 6px 6px; }
.cs-brand b { font-family: var(--display); font-size: 13px; letter-spacing: .02em; }
.cs-brand small { font-size: 9.5px; font-weight: 700; color: var(--cs-sub); border: 1px solid var(--cs-line); border-radius: 5px; padding: 0 4px; }
.cs-mark { width: 22px; height: 22px; border-radius: 7px; display: grid; place-items: center; background: var(--grad); color: #fff; }
.cs-nav { display: grid; gap: 2px; }
.cs-nav span { display: flex; align-items: center; gap: 8px; padding: 6px 8px; border-radius: 8px; color: var(--cs-sub); font-weight: 600; font-size: 11.5px; white-space: nowrap; }
.cs-nav em { font-style: normal; overflow: hidden; text-overflow: ellipsis; }
.cs-nav span.on { background: var(--cs-bg); color: var(--ink); box-shadow: var(--shadow-sm); }
.cs-nav span.on .ic { color: var(--brand); }
.cs-tenant { margin-top: auto; display: flex; gap: 8px; align-items: center; padding: 8px 6px 2px; border-top: 1px solid var(--cs-line); }
.cs-tenant b { display: block; font-size: 11px; white-space: nowrap; }
.cs-tenant small { display: block; font-size: 10px; color: var(--cs-sub); }
.cs-av { width: 26px; height: 26px; border-radius: 50%; display: grid; place-items: center; font-size: 10px; font-weight: 800; background: var(--cs-accbg); color: var(--cs-acc); flex: none; }
.cs-main { padding: 14px; display: grid; gap: 10px; align-content: start; min-width: 0; }
.cs-top { display: flex; justify-content: space-between; align-items: center; gap: 10px; }
.cs-top small { display: block; font-size: 10.5px; color: var(--cs-sub); }
.cs-top strong { display: block; font-family: var(--display); font-size: 15px; letter-spacing: -.01em; }
.cs-top-r { display: flex; gap: 6px; flex: none; }
.cs-pill, .cs-btn { display: inline-flex; align-items: center; gap: 5px; height: 24px; padding: 0 9px; border-radius: 999px; border: 1px solid var(--cs-line); font-size: 10.5px; font-weight: 700; color: var(--ink-2); background: var(--cs-bg); white-space: nowrap; }
.cs-btn { background: var(--grad); color: #fff; border-color: transparent; }
.cs-btn.sm { height: 22px; font-size: 10px; }
.cs-live { width: 7px; height: 7px; border-radius: 50%; background: var(--volt); box-shadow: 0 0 0 3px rgba(163, 230, 53, .25); animation: cs-pulse 1.8s infinite; }
@keyframes cs-pulse { 50% { box-shadow: 0 0 0 5px rgba(163, 230, 53, 0); } }
.cs-kpis { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 8px; }
.cs-kpis.k3 { grid-template-columns: repeat(3, minmax(0, 1fr)); }
.cs-kpi { border: 1px solid var(--cs-line); border-radius: 11px; padding: 9px 10px; min-width: 0; background: var(--cs-bg); }
.cs-kpi small { color: var(--cs-sub); font-size: 10px; display: block; white-space: nowrap; overflow: hidden; text-overflow: ellipsis; }
.cs-kpi b { font-family: var(--display); font-size: 15.5px; display: block; margin-top: 1px; white-space: nowrap; letter-spacing: -.01em; }
.cs-kpi-f { display: flex; align-items: center; justify-content: space-between; gap: 6px; margin-top: 2px; }
.cs-kpi em { font-style: normal; font-size: 10px; color: var(--cs-ok); font-weight: 700; white-space: nowrap; }
.cs-spark { width: 54px; height: 18px; color: var(--brand); flex: none; }
.cs-panel { border: 1px solid var(--cs-line); border-radius: 11px; padding: 10px 12px; min-width: 0; background: var(--cs-bg); }
.cs-ph { display: flex; justify-content: space-between; align-items: center; gap: 8px; font-weight: 700; font-size: 11.5px; margin-bottom: 8px; }
.cs-muted { color: var(--cs-sub); font-weight: 600; font-size: 10.5px; }
.cs-count { min-width: 18px; height: 18px; border-radius: 9px; background: var(--cs-badbg); color: var(--cs-bad); font-size: 10px; display: grid; place-items: center; padding: 0 5px; }
.cs-grid2 { display: grid; grid-template-columns: 1.35fr 1fr; gap: 10px; }
.cs-grid2.eq { grid-template-columns: 1fr 1fr; }
.cs-chart > svg { width: 100%; height: 118px; display: block; }
.cs-gridl line { stroke: var(--cs-line2); stroke-width: 1; vector-effect: non-scaling-stroke; }
.cs-bars rect { fill: var(--c2); opacity: .22; }
.cs-bars rect.pk { fill: var(--c1); opacity: .55; }
[data-theme="dark"] .cs-bars rect { opacity: .35; }
.cs-line { stroke: var(--brand); stroke-width: 2; }
.cs-legend { display: flex; align-items: center; gap: 5px; font-size: 10px; color: var(--cs-sub); font-weight: 600; }
.cs-legend i { width: 8px; height: 8px; border-radius: 2px; background: var(--c2); opacity: .4; margin-left: 4px; }
.cs-legend i.p { background: var(--c1); opacity: .8; }
.cs-legend i.l { height: 2px; background: var(--brand); opacity: 1; }
.cs-axis { display: flex; justify-content: space-between; color: var(--cs-sub); font-size: 9.5px; margin-top: 4px; }
.cs-row { display: flex; align-items: center; gap: 9px; padding: 7px 0; border-bottom: 1px solid var(--cs-line2); min-width: 0; }
.cs-row:last-child { border-bottom: 0; }
.cs-grow { flex: 1; min-width: 0; }
.cs-grow b { display: block; font-size: 11.5px; white-space: nowrap; overflow: hidden; text-overflow: ellipsis; }
.cs-grow small { display: block; font-size: 10px; color: var(--cs-sub); white-space: nowrap; overflow: hidden; text-overflow: ellipsis; }
.cs-sdot { width: 8px; height: 8px; border-radius: 50%; flex: none; background: var(--cs-off); }
.cs-sdot.ok { background: var(--cs-ok); } .cs-sdot.bad { background: var(--cs-bad); } .cs-sdot.warn { background: #f59e0b; }
.cs-sdot.chg { background: var(--volt); box-shadow: 0 0 0 3px rgba(163, 230, 53, .25); }
.cs-conn { display: flex; gap: 3px; }
.cs-conn i { width: 14px; height: 6px; border-radius: 3px; background: var(--cs-ok); opacity: .8; }
.cs-conn i.chg { background: var(--volt); opacity: 1; } .cs-conn i.bad { background: var(--cs-bad); }
.cs-chip { display: inline-flex; align-items: center; gap: 4px; padding: 2px 8px; border-radius: 999px; font-size: 10px; font-weight: 700; white-space: nowrap; flex: none; background: var(--cs-accbg); color: var(--cs-acc); }
.cs-chip.ok { background: var(--cs-okbg); color: var(--cs-ok); } .cs-chip.bad { background: var(--cs-badbg); color: var(--cs-bad); }
.cs-chip.warn { background: var(--cs-warnbg); color: var(--cs-warn); } .cs-chip.off { background: var(--cs-offbg); color: var(--cs-off); }
.cs-chip.chg { background: var(--cs-chgbg); color: var(--cs-chg); }
.cs-alert { display: flex; align-items: center; gap: 9px; padding: 7px 0; border-bottom: 1px solid var(--cs-line2); }
.cs-alert:last-child { border-bottom: 0; }
.cs-alert.cs-panel { padding: 9px 12px; border-bottom: 1px solid var(--cs-line); }
.cs-alert time { font-size: 10px; color: var(--cs-sub); flex: none; }
.cs-ai { width: 26px; height: 26px; border-radius: 8px; display: grid; place-items: center; flex: none; background: var(--cs-accbg); color: var(--cs-acc); }
.cs-alert.bad .cs-ai { background: var(--cs-badbg); color: var(--cs-bad); }
.cs-alert.warn .cs-ai { background: var(--cs-warnbg); color: var(--cs-warn); }
.cs-tblw { padding: 4px 10px; overflow: hidden; }
.cs-tbl { width: 100%; border-collapse: collapse; font-size: 11px; }
.cs-tbl td, .cs-tbl th { padding: 7px 6px; border-bottom: 1px solid var(--cs-line2); text-align: left; white-space: nowrap; }
.cs-tbl th { color: var(--cs-sub); font-weight: 700; font-size: 9.5px; text-transform: uppercase; letter-spacing: .05em; }
.cs-tbl tr:last-child td { border-bottom: 0; }
.cs-tbl td small { display: block; color: var(--cs-sub); font-size: 9.5px; }
.cs-tbl code, .cs-ledger code { font-family: ui-monospace, SFMono-Regular, Menlo, Consolas, monospace; font-size: 10.5px; color: var(--ink-2); }
.cs-role { font-size: 10px; font-weight: 700; padding: 2px 7px; border-radius: 6px; background: var(--cs-side); border: 1px solid var(--cs-line); }
/* tarif */
.cs-tabs { display: flex; gap: 4px; padding: 3px; border-radius: 10px; background: var(--cs-side); border: 1px solid var(--cs-line); width: fit-content; max-width: 100%; overflow: hidden; }
.cs-tabs span { padding: 4px 10px; border-radius: 7px; font-weight: 700; font-size: 10.5px; color: var(--cs-sub); white-space: nowrap; }
.cs-tabs span.on { background: var(--cs-bg); color: var(--ink); box-shadow: var(--shadow-sm); }
.cs-timeline { position: relative; height: 32px; border-radius: 8px; background: var(--cs-side); overflow: hidden; }
.cs-seg { position: absolute; top: 0; bottom: 0; display: grid; place-items: center; color: #fff; font-weight: 700; font-size: 10px; }
.cs-seg.off { background: #0ea5e9; } .cs-seg.mid { background: #2563eb; } .cs-seg.peak { background: #d97706; }
.cs-seg + .cs-seg { box-shadow: inset 2px 0 0 var(--cs-bg); }
/* bagi hasil */
.cs-split { display: flex; height: 28px; border-radius: 8px; overflow: hidden; font-size: 10px; font-weight: 700; color: #fff; }
.cs-split span { display: grid; place-items: center; white-space: nowrap; }
.cs-split .a { flex: 6; background: linear-gradient(90deg, #00b8e6, #1a8cff); }
.cs-split .b { flex: 4; background: #2563eb; }
.cs-ledger { margin-top: 8px; display: grid; }
.cs-ledger div { display: grid; grid-template-columns: auto 1fr auto auto; gap: 10px; align-items: center; padding: 6px 0; border-bottom: 1px solid var(--cs-line2); font-size: 10.5px; white-space: nowrap; }
.cs-ledger div:last-child { border-bottom: 0; }
.cs-ledger span { overflow: hidden; text-overflow: ellipsis; color: var(--ink-2); }
/* onboarding */
.cs-stepper { display: flex; gap: 6px; flex-wrap: wrap; }
.cs-step { display: inline-flex; align-items: center; gap: 6px; padding: 4px 10px 4px 4px; border-radius: 999px; border: 1px solid var(--cs-line); font-weight: 700; font-size: 10.5px; color: var(--cs-sub); }
.cs-step i { width: 18px; height: 18px; border-radius: 50%; display: grid; place-items: center; font-style: normal; font-size: 10px; background: var(--cs-side); }
.cs-step.done { color: var(--ink); } .cs-step.done i { background: var(--cs-okbg); color: var(--cs-ok); }
.cs-step.on { color: var(--ink); border-color: var(--brand); } .cs-step.on i { background: var(--grad); color: #fff; }
.cs-form { display: grid; gap: 5px; align-content: start; }
.cs-form label { font-size: 10px; font-weight: 700; color: var(--cs-sub); margin-top: 4px; }
.cs-segc { display: flex; gap: 3px; padding: 3px; border-radius: 9px; background: var(--cs-side); border: 1px solid var(--cs-line); }
.cs-segc span { flex: 1; text-align: center; padding: 4px 4px; border-radius: 6px; font-size: 10px; font-weight: 700; color: var(--cs-sub); white-space: nowrap; }
.cs-segc span.on { background: var(--cs-bg); color: var(--ink); box-shadow: var(--shadow-sm); }
.cs-field { display: flex; align-items: center; justify-content: space-between; gap: 6px; padding: 6px 9px; border-radius: 8px; border: 1px solid var(--cs-line); background: var(--cs-side); color: var(--cs-sub); min-width: 0; }
.cs-field code { font: 10.5px/1.3 ui-monospace, SFMono-Regular, Menlo, Consolas, monospace; color: var(--ink); overflow: hidden; text-overflow: ellipsis; white-space: nowrap; }
.cs-log { font: 10.5px/1.4 ui-monospace, SFMono-Regular, Menlo, Consolas, monospace; background: #07111f; border-color: rgba(148, 197, 255, .16); color: #cfe0f3; }
.cs-log .cs-ph { font-family: var(--font); color: #e6f0fb; }
.cs-log .cs-muted { color: #8fa1b8; }
.cs-log > div:not(.cs-ph) { display: grid; grid-template-columns: auto auto 1fr auto; gap: 8px; padding: 4px 0; border-bottom: 1px dashed rgba(148, 197, 255, .1); white-space: nowrap; }
.cs-log time { color: #64748b; }
.cs-log .d { color: #7dd3fc; } .cs-log .out .d { color: #fbbf24; }
.cs-log b { font-weight: 600; overflow: hidden; text-overflow: ellipsis; }
.cs-log .r { color: #bef264; }
/* firmware */
.cs-prog { margin-top: 8px; font-size: 10.5px; color: var(--cs-sub); display: grid; gap: 5px; }
.cs-prog i { display: block; height: 6px; border-radius: 3px; background: var(--cs-side); position: relative; overflow: hidden; }
.cs-prog i::after { content: ""; position: absolute; inset: 0 auto 0 0; width: var(--p); background: var(--grad); border-radius: 3px; }
/* peta */
.cs-mapwrap { display: grid; grid-template-columns: minmax(0, 1fr) 180px; gap: 10px; }
.cs-map { position: relative; border-radius: 11px; overflow: hidden; border: 1px solid var(--cs-line); aspect-ratio: 610 / 380; min-height: 220px; }
.cs-map > svg { position: absolute; inset: 0; width: 100%; height: 100%; }
.cs-m-bg { fill: #eef3f8; } .cs-m-blk rect { fill: #e1e9f2; } .cs-m-water { fill: #cfe7f7; }
.cs-m-road { stroke: #fff; stroke-width: 9; fill: none; }
.cs-m-route { stroke: var(--brand); stroke-width: 3; fill: none; stroke-dasharray: 6 5; stroke-linecap: round; }
[data-theme="dark"] .cs-m-bg { fill: #0a1626; } [data-theme="dark"] .cs-m-blk rect { fill: #0f2036; } [data-theme="dark"] .cs-m-water { fill: #0b2a45; }
[data-theme="dark"] .cs-m-road { stroke: #18304d; }
.cs-pin { position: absolute; transform: translate(-50%, -50%); width: 22px; height: 22px; border-radius: 50%; display: grid; place-items: center; color: #fff; background: var(--cs-ok); box-shadow: 0 0 0 3px var(--cs-bg), 0 6px 14px -4px rgba(10, 26, 47, .5); }
.cs-pin.bad { background: var(--cs-bad); } .cs-pin.off { background: #64748b; }
.cs-pin.chg { background: #65a30d; box-shadow: 0 0 0 3px var(--cs-bg), 0 0 0 7px rgba(163, 230, 53, .35); }
.cs-pop { position: absolute; transform: translate(14px, -110%); background: var(--cs-bg); border: 1px solid var(--cs-line); border-radius: 10px; padding: 7px 9px; box-shadow: var(--shadow); display: grid; gap: 2px; white-space: nowrap; }
.cs-pop b { font-size: 11px; } .cs-pop small { font-size: 10px; color: var(--cs-sub); }
.cs-maplist { display: grid; align-content: start; min-width: 0; }
.cs-filt { display: flex; gap: 4px; margin-bottom: 4px; flex-wrap: wrap; }
.cs-filt span { padding: 3px 8px; border-radius: 999px; border: 1px solid var(--cs-line); font-size: 10px; font-weight: 700; color: var(--cs-sub); }
.cs-filt span.on { background: var(--ink); color: var(--page); border-color: var(--ink); }
/* responsif berdasarkan lebar mockup itu sendiri */
@container (max-width: 760px) {
  .cs-app { grid-template-columns: 52px minmax(0, 1fr); }
  .cs-brand b, .cs-brand small, .cs-nav em, .cs-tenant > span:last-child { display: none; }
  .cs-brand { padding: 2px 4px 6px; } .cs-nav span { justify-content: center; padding: 7px 0; } .cs-tenant { justify-content: center; padding: 8px 0 2px; }
  .cs-mapwrap { grid-template-columns: 1fr; } .cs-maplist { display: none; }
}
@container (max-width: 600px) {
  .cs-kpis { grid-template-columns: repeat(2, minmax(0, 1fr)); } .cs-kpis.k3 { grid-template-columns: repeat(3, minmax(0, 1fr)); }
  .cs-grid2, .cs-grid2.eq { grid-template-columns: 1fr; }
}
@container (max-width: 480px) {
  .cs-app { grid-template-columns: 1fr; min-height: 0; } .cs-side { display: none; }
  .cs-main { padding: 10px; } .cs-sample { display: none; }
  .cs-kpis.k3 { grid-template-columns: 1fr 1fr; } .cs-kpis.k3 .cs-kpi:last-child { display: none; }
  .cs-tbl th:nth-child(3), .cs-tbl td:nth-child(3) { display: none; }
  .cs-top-r .cs-pill:not(:first-child) { display: none; }
  .cs-ledger div { grid-template-columns: auto 1fr auto; } .cs-ledger div > span:nth-of-type(2) { display: none; }
  .cs-log > div:not(.cs-ph) { grid-template-columns: auto 1fr auto; } .cs-log time { display: none; }
}

/* Blok kode */
.cs-code { margin: 0; border-radius: 16px; background: #07111f; border: 1px solid rgba(148, 197, 255, .16); color: #d6e4f5; overflow: hidden; box-shadow: var(--shadow-lg); text-align: left; min-width: 0; }
.cs-code figcaption { display: flex; gap: 8px; align-items: center; padding: 10px 14px; border-bottom: 1px solid rgba(148, 197, 255, .12); color: #9db0c7; font-size: 12px; font-weight: 600; background: rgba(255, 255, 255, .02); }
.cs-code figcaption span { flex: 1; min-width: 0; overflow: hidden; text-overflow: ellipsis; white-space: nowrap; font-family: ui-monospace, SFMono-Regular, Menlo, Consolas, monospace; }
.cs-code figcaption em { font-style: normal; font-size: 10.5px; font-weight: 700; padding: 2px 8px; border-radius: 999px; background: rgba(0, 212, 255, .12); color: #7dd3fc; }
.cs-code pre { margin: 0; padding: 16px 18px; overflow-x: auto; font: 12.5px/1.7 ui-monospace, SFMono-Regular, Menlo, Consolas, monospace; tab-size: 2; }
.cs-code pre:focus-visible { outline: 2px solid var(--c1); outline-offset: -2px; }
.cs-code .k { color: #7dd3fc; } .cs-code .s { color: #bef264; } .cs-code .n { color: #fbbf24; } .cs-code .c { color: #6b7f99; } .cs-code .f { color: #c4b5fd; }

/* 20-bisnis.css */
/* Area Bisnis & Platform (Agent B) — semua kelas berawalan b-. Memakai token & komponen bersama dari 00-base.css. */

/* Hero */
.b-hero-eb { margin-top: 26px; }
.b-hero-specs { margin-top: 26px; }
.b-hero-art { min-width: 0; }
.b-hero .phero-in { align-items: center; }
.b-hero code, .night code { font-family: var(--mono); }
.b-mt { margin-top: 26px; }
.b-note { display: flex; flex-wrap: wrap; align-items: center; gap: 10px; margin-top: 22px; font-size: 14.5px; color: var(--muted); }

/* Diagram ekosistem */
.b-eco { position: relative; aspect-ratio: 600 / 520; width: 100%; max-width: 600px; margin: 0 auto; container-type: inline-size; }
.b-eco > svg { position: absolute; inset: 0; width: 100%; height: 100%; overflow: visible; }
.b-eco-base { fill: none; stroke: rgba(125, 211, 252, .22); stroke-width: 1.5; stroke-dasharray: 3 5; }
.b-eco-ring { fill: none; stroke: rgba(125, 211, 252, .12); stroke-width: 1; }
.b-eco-ring.r2 { stroke-dasharray: 2 8; }
.b-eco-n { position: absolute; transform: translateY(-50%); width: 28%; display: flex; align-items: center; gap: 9px; padding: 9px 11px; border-radius: 14px; background: rgba(10, 24, 44, .78); border: 1px solid var(--night-line); backdrop-filter: blur(10px); -webkit-backdrop-filter: blur(10px); box-shadow: 0 16px 34px -18px rgba(0, 0, 0, .8); font-size: 12.5px; line-height: 1.25; color: var(--night-ink); }
.b-eco-n.l { left: 0; }
.b-eco-n.r { right: 0; }
.b-eco-n b { display: block; color: #fff; font-size: 13px; }
.b-eco-n small { display: block; color: var(--night-muted); font-size: 11px; }
.b-eco-i { width: 30px; height: 30px; border-radius: 9px; display: grid; place-items: center; flex: none; background: rgba(0, 212, 255, .12); color: #6fe0ff; }
.b-eco-hub { position: absolute; left: 50%; top: 50%; transform: translate(-50%, -50%); width: 20%; aspect-ratio: 1; border-radius: 50%; display: grid; place-content: center; justify-items: center; text-align: center; gap: 2px; background: radial-gradient(circle at 30% 25%, #0f2a4a, #071427 70%); border: 1px solid rgba(0, 212, 255, .45); box-shadow: 0 0 0 8px rgba(0, 212, 255, .06), 0 0 60px -6px rgba(0, 212, 255, .55); }
.b-eco-hub b { color: #fff; font-family: var(--display); font-size: 13px; line-height: 1.1; }
.b-eco-hub small { color: #6fe0ff; font-size: 10px; font-weight: 700; }
.b-eco-mark { width: 34px; height: 34px; border-radius: 11px; display: grid; place-items: center; background: var(--grad); color: #fff; margin-bottom: 4px; box-shadow: 0 8px 20px -6px rgba(0, 212, 255, .7); }
@container (max-width: 470px) {
  .b-eco-n { padding: 6px 7px; gap: 6px; border-radius: 11px; width: 30%; }
  .b-eco-n b { font-size: 11px; } .b-eco-n small { font-size: 9.5px; }
  .b-eco-i { width: 22px; height: 22px; border-radius: 7px; } .b-eco-i .ic { width: 13px; height: 13px; }
  .b-eco-hub { width: 24%; } .b-eco-hub b { font-size: 10.5px; } .b-eco-hub small { font-size: 8.5px; }
  .b-eco-mark { width: 24px; height: 24px; border-radius: 8px; } .b-eco-mark .ic { width: 15px; height: 15px; }
}
@container (max-width: 380px) { .b-eco-n small { display: none; } }

/* Segmen (hub) */
.b-seg { display: grid; grid-template-columns: repeat(6, minmax(0, 1fr)); gap: 20px; }
.b-seg-c { grid-column: span 2; position: relative; overflow: hidden; display: flex; flex-direction: column; padding: 28px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); transition: transform .2s, box-shadow .2s, border-color .2s; }
.b-seg-c.big { grid-column: span 4; background: radial-gradient(120% 120% at 100% 0%, var(--soft) 0%, var(--surface) 55%); }
.b-seg-c:nth-child(2) { grid-column: span 2; }
.b-seg-c:hover { transform: translateY(-3px); box-shadow: var(--shadow); border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); }
.b-seg-c h3 { font-size: 21px; margin: 18px 0 8px; }
.b-seg-c.big h3 { font-size: 26px; }
.b-seg-c p { color: var(--muted); font-size: 15px; max-width: 520px; }
.b-seg-c ul { margin: 18px 0 22px; display: grid; gap: 8px; }
.b-seg-c li { display: flex; gap: 8px; align-items: flex-start; font-size: 14.5px; font-weight: 600; color: var(--ink-2); }
.b-seg-c li .ic { color: var(--brand); margin-top: 3px; }
.b-pkg-cta { margin-top: auto; display: flex; flex-wrap: wrap; align-items: center; gap: 10px 18px; position: relative; z-index: 1; }
.b-seg-c .b-pkg-cta .link, .b-model .b-pkg-cta .link { font-size: 14.5px; }
.b-seg-art { display: flex; flex-wrap: wrap; gap: 8px; margin-top: 22px; padding-top: 20px; border-top: 1px dashed var(--line); }
.b-seg-art span { display: inline-flex; align-items: center; gap: 6px; padding: 6px 11px; border-radius: 999px; background: var(--surface); border: 1px solid var(--line); font-size: 13px; font-weight: 600; color: var(--ink-2); }
.b-seg-art .ic { color: var(--brand); }

/* Mengapa EVONE */
.b-why-g { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 18px; }
.b-why-g .card { display: flex; flex-direction: column; }
.b-why-g .card p { flex: 1; }
.b-why-spec { margin-top: 18px; align-self: flex-start; font-size: 12px; font-weight: 800; letter-spacing: .03em; padding: 5px 11px; border-radius: 999px; background: rgba(0, 212, 255, .1); color: #6fe0ff; border: 1px solid rgba(0, 212, 255, .22); }
.b-why-dash { margin: clamp(48px, 6vw, 72px) auto 0; max-width: 1040px; }

/* Peran */
.b-roles { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; position: relative; }
.b-role { padding: 28px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); }
.b-role h3 { font-size: 20px; margin: 18px 0 8px; }
.b-role p { color: var(--muted); font-size: 15px; }
.b-role.is-evone { background: var(--night); border-color: rgba(0, 212, 255, .3); box-shadow: 0 30px 60px -36px rgba(0, 120, 255, .6); }
.b-role.is-evone h3 { color: #fff; }
.b-role.is-evone p { color: var(--night-muted); }

/* Tantangan → solusi */
.b-probs { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; }
.b-prob { display: flex; flex-direction: column; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); overflow: hidden; }
.b-prob-q { padding: 26px 26px 22px; flex: 1; }
.b-prob-q h3 { font-size: 19px; margin: 12px 0 8px; }
.b-prob-q p { color: var(--muted); font-size: 15px; }
.b-prob-a { padding: 18px 26px 22px; background: var(--canvas); border-top: 1px solid var(--line); }
.sec-alt .b-prob-a { background: var(--soft); }
.b-prob-a p { font-weight: 600; font-size: 15px; color: var(--ink); margin-top: 8px; }
.b-lbl { display: inline-flex; align-items: center; gap: 6px; font-size: 12px; font-weight: 800; letter-spacing: .06em; text-transform: uppercase; color: var(--muted); }
.b-lbl.ok { color: var(--brand-ink); }

/* Tab tipe lokasi */
.b-tabs .tabs { margin-bottom: 28px; }
.b-tabs .tab .ic { color: var(--brand); }
.b-lok { display: grid; grid-template-columns: minmax(0, 1.25fr) minmax(0, 1fr); gap: 28px; padding: clamp(24px, 4vw, 44px); border-radius: var(--r-xl); border: 1px solid var(--line); background: var(--surface); box-shadow: var(--shadow-sm); }
.b-lok:focus-visible { outline-offset: 4px; }
.b-lok-main h3 { font-size: clamp(24px, 2.6vw, 32px); margin: 16px 0 12px; letter-spacing: -.03em; }
.b-lok-main .lead { font-size: 16.5px; }
.b-lok-meta { display: grid; grid-template-columns: 1fr 1fr; gap: 14px; margin-top: 22px; }
.b-lok-meta > div { padding: 14px 16px; border-radius: 14px; background: var(--canvas); }
.b-lok-meta p { margin-top: 6px; font-size: 14.5px; color: var(--ink-2); }
.b-chips { display: flex; flex-wrap: wrap; gap: 6px; }
.b-chips span { padding: 3px 10px; border-radius: 999px; background: var(--surface); border: 1px solid var(--line); font-size: 13px; font-weight: 600; }
.b-lok-more { margin-top: 22px; }
.b-lok-needs { display: grid; gap: 12px; align-content: start; }
.b-lok-needs > div { position: relative; padding: 20px 20px 20px 22px; border-radius: 16px; background: var(--night); color: var(--night-ink); overflow: hidden; }
.b-lok-needs > div::before { content: ""; position: absolute; left: 0; top: 14px; bottom: 14px; width: 3px; border-radius: 3px; background: var(--grad); box-shadow: 0 0 12px rgba(0, 212, 255, .6); }
.b-lok-needs b { color: #fff; display: block; font-size: 15.5px; }
.b-lok-needs p { color: var(--night-muted); font-size: 14.5px; margin-top: 4px; }

/* Daftar bernomor (migrasi) */
.b-olist { counter-reset: o; margin: 26px 0 0; padding: 0; list-style: none; display: grid; gap: 14px; }
.b-olist li { counter-increment: o; display: grid; grid-template-columns: 34px 1fr; column-gap: 12px; }
.b-olist li::before { content: counter(o); grid-row: span 2; width: 30px; height: 30px; border-radius: 50%; display: grid; place-items: center; font-family: var(--display); font-weight: 700; font-size: 13px; color: var(--brand-ink); border: 2px solid var(--c1); }
.b-olist b { display: block; }
.b-olist span { color: var(--muted); font-size: 15px; }

/* Diagram tenant */
.b-tenants { border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); padding: 18px; box-shadow: var(--shadow); }
.b-ten-top, .b-ten-foot { display: flex; align-items: center; gap: 8px; font-size: 13px; font-weight: 700; color: var(--muted); }
.b-ten-top .ic, .b-ten-foot .ic { color: var(--brand); }
.b-ten-grid { display: grid; grid-template-columns: minmax(0, 1fr) 28px minmax(0, 1fr); gap: 8px; margin: 14px 0; align-items: stretch; }
.b-ten { border-radius: 16px; padding: 14px; border: 1px solid var(--line); background: var(--canvas); min-width: 0; }
.b-ten.a { box-shadow: inset 0 3px 0 var(--c1); }
.b-ten.b { box-shadow: inset 0 3px 0 var(--c2); }
.b-ten-h { display: flex; align-items: center; gap: 6px; flex-wrap: wrap; }
.b-ten-h b { font-size: 14.5px; }
.b-ten-h span { font-size: 12px; color: var(--muted); }
.b-ten-h .ic { color: var(--brand); }
.b-ten-st { display: grid; gap: 6px; margin: 12px 0; }
.b-ten-st span { display: flex; align-items: center; gap: 6px; padding: 6px 9px; border-radius: 9px; background: var(--surface); border: 1px solid var(--line); font: 600 12px/1.2 var(--mono); }
.b-ten-st .ic { color: var(--ok); }
.b-ten-r { display: flex; flex-wrap: wrap; gap: 4px; }
.b-ten-r em { font-style: normal; font-size: 11px; font-weight: 700; padding: 2px 8px; border-radius: 6px; background: var(--soft); color: var(--brand-ink); }
.b-ten-wall { display: grid; place-items: center; position: relative; color: var(--muted); }
.b-ten-wall::before { content: ""; position: absolute; top: 0; bottom: 0; left: 50%; border-left: 2px dashed var(--line); }
.b-ten-wall .ic { position: relative; background: var(--surface); padding: 4px; width: 24px; height: 24px; border-radius: 50%; border: 1px solid var(--line); }

/* Ponsel */
.b-phone { display: flex; justify-content: center; }

/* Daftar event */
.b-evlist { display: grid; gap: 2px; margin: 22px 0 0; }
.b-evlist li { display: grid; grid-template-columns: minmax(0, 190px) minmax(0, 1fr); gap: 14px; padding: 10px 0; border-bottom: 1px solid var(--line); font-size: 14.5px; align-items: baseline; }
.night .b-evlist li { border-color: var(--night-line); }
.b-evlist code, .b-bullets code, .b-msgs code, .b-api .cmp code, .b-int code { font: 600 12.5px/1.4 var(--mono); padding: 2px 7px; border-radius: 6px; background: var(--soft); color: var(--brand-ink); overflow-wrap: anywhere; }
.night .b-evlist code, .night .b-bullets code, .night .b-int code { background: rgba(0, 212, 255, .1); color: #8be9ff; }
.b-evlist li > code { justify-self: start; }
.b-evlist span { color: var(--muted); }
.night .b-evlist span { color: var(--night-muted); }
.b-bullets { display: grid; gap: 10px; margin-top: 22px; }
.b-bullets li { display: flex; gap: 10px; align-items: flex-start; font-size: 15px; }
.b-bullets li .ic { color: var(--brand); margin-top: 3px; }
.night .b-bullets li .ic { color: #6fe0ff; }
.night .b-bullets li span { color: var(--night-ink); }
.b-h3 { font-size: 18px; margin-top: 30px; }
.b-h3:first-child { margin-top: 0; }

/* Audiens hunian */
.b-aud { display: grid; grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 20px; }
.b-aud-c { padding: clamp(24px, 3.5vw, 40px); border-radius: var(--r-xl); border: 1px solid var(--line); background: var(--surface); }
.b-aud-c h3 { font-size: 24px; margin: 18px 0 8px; }
.b-aud-c p { color: var(--muted); }
.b-home { display: flex; align-items: center; justify-content: space-between; gap: 24px; flex-wrap: wrap; padding: clamp(24px, 4vw, 40px); border-radius: var(--r-xl); border: 1px dashed color-mix(in srgb, var(--brand) 45%, var(--line)); background: var(--grad-soft); }
.b-home h2 { font-size: clamp(24px, 2.6vw, 32px); margin: 12px 0 8px; }
.b-home p { color: var(--muted); max-width: 640px; }

/* Tabel */
.b-cmp { margin-top: 8px; }
.b-cmp:focus-visible { outline-offset: 3px; }
.b-msgs { display: flex; flex-wrap: wrap; gap: 6px; }
.b-msgs code { font-size: 12px; font-weight: 600; }
.b-cmp .cmp tbody th { color: var(--ink); }

/* Platform */
.b-phero-plat { padding-bottom: 0; }
.b-phero-plat .phero-in { padding-bottom: 8px; }
.b-plat-shot { position: relative; max-width: 1100px; margin: clamp(40px, 5vw, 64px) auto 0; transform: translateY(1px); }
.b-plat-shot .cs-browser { border-bottom-left-radius: 0; border-bottom-right-radius: 0; }
.b-plat-glow { position: absolute; left: 10%; right: 10%; top: -40px; height: 160px; background: radial-gradient(closest-side, rgba(0, 212, 255, .45), transparent); filter: blur(30px); pointer-events: none; }
.b-subnav .wrap { scroll-behavior: smooth; }
.b-int { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; }
.b-int .card h3 { display: flex; align-items: center; gap: 10px; flex-wrap: wrap; }
.b-caps { overflow: hidden; border-bottom: 1px solid var(--line); }
.b-caps .marquee-track { flex-wrap: nowrap; }
.b-split-sec .split-art .cs-browser, .b-split-sec .split-art .cs-code { width: 100%; }

/* Developer */
.b-ocpp { display: grid; grid-template-columns: minmax(0, 1fr) minmax(0, 1fr); gap: 20px; margin-bottom: 28px; }
.b-ver { display: flex; gap: 18px; padding: 26px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); }
.b-ver h3 { font-size: 19px; margin-bottom: 8px; }
.b-ver p { color: var(--muted); font-size: 15px; }
.b-ver-n { flex: none; font-family: var(--display); font-weight: 700; font-size: 28px; letter-spacing: -.04em; line-height: 1; background: var(--grad); -webkit-background-clip: text; background-clip: text; color: transparent; min-width: 64px; }
.b-ocpp-code { grid-column: 1 / -1; }
.b-sp { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; }
.b-sp-c { padding: 28px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); }
.b-sp-c h3 { font-size: 20px; margin: 18px 0 2px; }
.b-sp-c b { display: block; color: var(--brand-ink); font-size: 14.5px; margin-bottom: 10px; }
.b-sp-c p { color: var(--muted); font-size: 15px; }
.b-sp-bar { display: flex; gap: 4px; margin-bottom: 18px; }
.b-sp-bar i { flex: 1; height: 5px; border-radius: 3px; background: var(--line); }
.b-sp-bar i:nth-child(-n+1) { background: var(--c1); }
.b-sp-bar[style*="--lv:2"] i:nth-child(-n+2), .b-sp-bar[style*="--lv:3"] i { background: var(--grad); }
.b-layers { display: grid; max-width: 880px; margin: 0 auto; }
.b-layer { position: relative; display: flex; gap: 20px; align-items: flex-start; padding: 26px 28px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); overflow: hidden; }
.b-layer:nth-child(1) { background: linear-gradient(180deg, var(--soft), var(--surface)); }
.b-layer h3 { font-size: 19px; margin-bottom: 6px; }
.b-layer p { color: var(--muted); font-size: 15px; }
.b-layer-n { position: absolute; right: 22px; top: 14px; font-family: var(--display); font-weight: 700; font-size: 44px; color: var(--line); letter-spacing: -.04em; }
.b-tags { display: flex; flex-wrap: wrap; gap: 6px; margin-top: 14px; }
.b-layer-link { height: 34px; display: grid; place-items: center; }
.b-layer-link i { width: 2px; height: 100%; background: linear-gradient(var(--c1), var(--c2)); box-shadow: 0 0 10px rgba(0, 212, 255, .7); position: relative; overflow: hidden; }
.b-layer-link i::after { content: ""; position: absolute; left: 0; right: 0; top: -40%; height: 40%; background: #fff; opacity: .9; animation: bdrop 1.6s linear infinite; }
@keyframes bdrop { to { top: 100%; } }
.b-api { display: grid; grid-template-columns: minmax(0, 1fr) minmax(0, 1fr); gap: 28px; align-items: start; }
.b-api .cmp { min-width: 0; }
.b-wh { display: grid; grid-template-columns: minmax(0, 1fr) minmax(0, 1.05fr); gap: clamp(28px, 4vw, 56px); align-items: start; }
.b-wh-code { display: grid; gap: 18px; }

/* Kemitraan */
.b-models { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 20px; align-items: stretch; }
.b-model { position: relative; display: flex; flex-direction: column; padding: 30px; border-radius: var(--r-xl); border: 1px solid var(--line); background: var(--surface); }
.b-model.hl { border-color: color-mix(in srgb, var(--c1) 55%, var(--line)); box-shadow: 0 30px 60px -36px rgba(0, 140, 255, .55); }
.b-model-tag { position: absolute; top: 18px; right: 18px; font-size: 11.5px; font-weight: 800; padding: 4px 10px; border-radius: 999px; background: var(--soft); color: var(--brand-ink); }
.b-model h3 { font-size: 22px; margin: 18px 0 6px; }
.b-model-who { color: var(--muted); font-size: 15px; }
.b-model dl { margin: 20px 0 22px; display: grid; gap: 14px; flex: 1; }
.b-model dt { font-size: 12px; font-weight: 800; letter-spacing: .06em; text-transform: uppercase; color: var(--muted); }
.b-model dd { margin: 4px 0 0; font-size: 15px; color: var(--ink-2); }
.b-clear { display: flex; gap: 18px; align-items: flex-start; margin-top: 28px; padding: 24px 26px; border-radius: var(--r-lg); border: 1px solid color-mix(in srgb, var(--brand) 35%, var(--line)); background: var(--surface); }
.b-clear h3 { font-size: 18px; margin-bottom: 6px; }
.b-clear p { color: var(--muted); }

/* Responsif */
@media (max-width: 1080px) {
  .b-seg { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .b-seg-c, .b-seg-c:nth-child(2) { grid-column: span 1; }
  .b-seg-c.big { grid-column: span 2; }
  .b-why-g, .b-int { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .b-roles, .b-probs, .b-sp, .b-models { grid-template-columns: minmax(0, 1fr); }
  .b-roles, .b-probs, .b-sp { max-width: 640px; }
  .b-lok { grid-template-columns: minmax(0, 1fr); }
  .b-api, .b-wh, .b-ocpp { grid-template-columns: minmax(0, 1fr); }
  .b-hero-art { max-width: 640px; width: 100%; margin: 0 auto; }
  .b-models { max-width: 640px; margin: 0 auto; }
}
@media (max-width: 680px) {
  .b-seg, .b-why-g, .b-int, .b-aud { grid-template-columns: minmax(0, 1fr); }
  .b-seg-c.big { grid-column: span 1; }
  .b-seg-c, .b-role, .b-sp-c, .b-model { padding: 24px; }
  .b-seg-c.big h3 { font-size: 23px; }
  .b-tabs .tabs { display: grid; grid-template-columns: 1fr 1fr; width: 100%; }
  .b-tabs .tab { justify-content: flex-start; padding: 0 12px; font-size: 13.5px; height: 42px; }
  .b-lok { border-radius: var(--r-lg); padding: 22px 18px; }
  .b-lok-meta { grid-template-columns: minmax(0, 1fr); }
  .b-evlist li { grid-template-columns: minmax(0, 1fr); gap: 4px; }
  .b-ver { flex-direction: column; gap: 10px; padding: 22px; }
  .b-layer { flex-direction: column; gap: 14px; padding: 22px; }
  .b-layer-n { font-size: 34px; }
  .b-clear { flex-direction: column; }
  .b-ten-grid { grid-template-columns: minmax(0, 1fr); }
  .b-ten-wall { height: 26px; } .b-ten-wall::before { left: 0; right: 0; top: 50%; bottom: auto; border-left: 0; border-top: 2px dashed var(--line); }
  .b-plat-shot { margin-left: -4px; margin-right: -4px; }
}
@media (prefers-reduced-motion: reduce) { .b-layer-link i::after { display: none; } }
.phero.solo .b-hero-specs { justify-content: center; }
.b-api .cmp code, .b-evlist li > code { white-space: nowrap; overflow-wrap: normal; }
.b-tabs .tab { text-align: left; }

/* 30-pengemudi.css */
/* Halaman Pengemudi, Tentang, FAQ, Kontak (wilayah Agent C) — awalan p- */

/* ---------- Visual ponsel di hero & bagian fitur ---------- */
.p-duo { position: relative; height: 640px; max-width: 520px; margin: 0 auto; }
.p-duo-line { position: absolute; inset: 20px -20px 0 -20px; width: calc(100% + 40px); height: 100%; pointer-events: none; }
.p-duo-front, .p-duo-back { position: absolute; top: 20px; }
.p-duo-front { right: 4%; z-index: 2; }
.p-duo-back { left: 0; top: 70px; z-index: 1; transform: rotate(-5deg) scale(.9); transform-origin: bottom left; opacity: .92; filter: saturate(.9); }
.p-one { position: relative; display: flex; justify-content: center; padding: 10px 0; }
.p-float { position: absolute; z-index: 3; display: flex; gap: 10px; align-items: center; max-width: 250px; padding: 11px 14px; border-radius: 16px; font-size: 12.5px; line-height: 1.35; color: var(--muted); background: color-mix(in srgb, var(--surface) 88%, transparent); border: 1px solid var(--line); box-shadow: var(--shadow); backdrop-filter: blur(12px); -webkit-backdrop-filter: blur(12px); animation: p-bob 7s ease-in-out infinite; }
.p-float b { display: block; color: var(--ink); font-size: 13.5px; }
.p-float > span { width: 34px; height: 34px; border-radius: 10px; display: grid; place-items: center; flex: none; background: var(--grad); color: #fff; }
.night .p-float { background: rgba(9, 22, 40, .78); border-color: var(--night-line); color: var(--night-muted); box-shadow: 0 20px 44px -20px rgba(0, 0, 0, .8); }
.night .p-float b { color: #fff; }
.p-duo .p-f1 { left: -4%; top: 30px; }
.p-duo .p-f2 { right: -2%; bottom: 40px; animation-delay: -3.5s; }
.p-one .p-float { max-width: 215px; }
.p-one .p-f1 { left: max(0px, calc(50% - 330px)); bottom: 7%; }
@keyframes p-bob { 50% { transform: translateY(-8px); } }
.p-note { display: flex; gap: 10px; align-items: flex-start; margin-top: 22px; padding: 14px 16px; border-radius: 14px; background: var(--canvas); border: 1px solid var(--line); color: var(--muted); font-size: 14.5px; }
.p-note .ic { color: var(--brand); margin-top: 2px; }
.p-note a { color: var(--brand-ink); font-weight: 700; text-decoration: underline; text-underline-offset: 3px; }
.sec-alt .p-note { background: var(--surface); }
.night .p-note { background: rgba(255, 255, 255, .04); border-color: var(--night-line); color: var(--night-muted); }

/* Tiga ponsel kecil */
.p-trio { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 28px; }
.p-trio-i { text-align: center; }
.p-trio-i h3 { font-size: 20px; margin: 22px 0 8px; }
.p-trio-i p { color: var(--muted); font-size: 15px; max-width: 340px; margin: 0 auto; }
.p-mini { display: flex; justify-content: center; zoom: .82; }

/* Segera hadir */
.p-soon-grid { display: grid; grid-template-columns: minmax(0, 1.05fr) minmax(0, .95fr); gap: clamp(32px, 5vw, 72px); align-items: center; }
.p-soon-list { display: grid; gap: 10px; margin-top: 28px; }
.p-soon-i { display: flex; gap: 14px; align-items: center; padding: 16px 18px; border-radius: var(--r); border: 1px solid var(--line); background: var(--surface); transition: border-color .2s, transform .2s; }
a.p-soon-i:hover { border-color: color-mix(in srgb, var(--brand) 45%, var(--line)); transform: translateX(3px); }
.p-soon-i > div { flex: 1; min-width: 0; }
.p-soon-i b { display: flex; flex-wrap: wrap; gap: 8px; align-items: center; font-size: 16px; }
.p-soon-i span:not(.soon):not(.ico) { color: var(--muted); font-size: 14.5px; }
.p-soon-i > .ic { color: var(--muted); }
.p-soon-art { display: flex; justify-content: center; gap: 0; }
.p-soon-art .phone { zoom: .86; }
.p-soon-art .phone + .phone { margin-left: -60px; margin-top: 70px; }

/* Unduh */
.p-dl-in { position: relative; display: grid; grid-template-columns: minmax(0, 1.2fr) minmax(0, .8fr); gap: 40px; align-items: center; }
.p-dl-art { display: flex; justify-content: center; margin-bottom: -150px; }
.p-dl { padding-bottom: 72px; overflow: hidden; }
.p-dl .lead { color: var(--night-muted); }

/* Catatan EV: jenis catatan */
.p-kinds { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 1px; background: var(--line); border: 1px solid var(--line); border-radius: var(--r-lg); overflow: hidden; }
.p-kind { background: var(--surface); padding: 30px 28px; }
.p-kind h3 { font-size: 19px; margin: 18px 0 8px; }
.p-kind p { color: var(--muted); font-size: 15px; }

/* Rumus biaya */
.p-calc { display: grid; grid-template-columns: minmax(0, .9fr) minmax(0, 1.1fr); gap: clamp(32px, 5vw, 64px); align-items: center; }
.p-formula { border-radius: var(--r-lg); padding: 28px; background: var(--night); color: var(--night-ink); position: relative; overflow: hidden; isolation: isolate; box-shadow: var(--shadow-lg); }
.p-formula::before { content: ""; position: absolute; z-index: -1; width: 340px; height: 340px; right: -120px; top: -160px; border-radius: 50%; background: rgba(0, 212, 255, .22); filter: blur(70px); }
.p-formula-h { display: flex; justify-content: space-between; align-items: center; font-weight: 700; color: #fff; margin-bottom: 22px; }
.p-formula .tag { background: rgba(163, 230, 53, .14); color: var(--volt); }
.p-eq { display: grid; grid-template-columns: minmax(0, 1fr) auto minmax(0, 1fr) auto minmax(0, 1fr); gap: 10px; align-items: center; }
.p-eq > div { padding: 14px; border-radius: 14px; background: rgba(255, 255, 255, .05); border: 1px solid var(--night-line); min-width: 0; }
.p-eq i { display: block; font-style: normal; font-size: 12.5px; color: var(--night-muted); line-height: 1.35; margin-bottom: 6px; }
.p-eq b { font-family: var(--display); font-size: clamp(17px, 1.8vw, 22px); color: #fff; letter-spacing: -.02em; white-space: nowrap; }
.p-eq > span { font-family: var(--display); font-size: 22px; color: #6fe0ff; }
.p-eq .p-eq-r { background: linear-gradient(140deg, rgba(0, 212, 255, .22), rgba(37, 99, 235, .3)); border-color: rgba(0, 212, 255, .4); }
.p-formula > p { margin-top: 18px; font-size: 13.5px; color: var(--night-muted); }

/* Kotak jujur & pasangan tautan */
.p-honest { display: flex; gap: 20px; align-items: flex-start; padding: clamp(24px, 4vw, 40px); border-radius: var(--r-lg); border: 1px solid color-mix(in srgb, var(--brand) 30%, var(--line)); background: linear-gradient(140deg, var(--soft), var(--surface) 60%); }
.p-honest h2 { font-size: clamp(22px, 2.4vw, 28px); margin-bottom: 10px; }
.p-honest p { color: var(--ink-2); font-size: 16.5px; max-width: 820px; }
.p-honest a { color: var(--brand-ink); font-weight: 700; text-decoration: underline; text-underline-offset: 3px; }
.p-pair { display: grid; grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 20px; }
.p-pair-i { display: flex; gap: 16px; align-items: center; padding: 24px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); transition: border-color .2s, box-shadow .2s, transform .2s; }
.p-pair-i:hover { border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); box-shadow: var(--shadow); transform: translateY(-2px); }
.p-pair-i > div { flex: 1; min-width: 0; }
.p-pair-i b { display: block; font-size: 17px; font-family: var(--display); letter-spacing: -.01em; margin-bottom: 4px; }
.p-pair-i span:not(.ico) { color: var(--muted); font-size: 14.5px; }
.p-pair-i > .ic { color: var(--muted); }

/* ---------- Tentang ---------- */
.p-mission { position: relative; overflow: hidden; isolation: isolate; border-radius: var(--r-xl); padding: clamp(28px, 4vw, 44px); background: var(--night); color: var(--night-ink); box-shadow: var(--shadow-lg); }
.p-mission::before { content: ""; position: absolute; z-index: -1; inset: 0; background: radial-gradient(60% 60% at 90% 0%, rgba(0, 212, 255, .25), transparent 70%), radial-gradient(60% 60% at 0% 100%, rgba(37, 99, 235, .3), transparent 70%); }
.p-mission .eyebrow { color: #6fe0ff; }
.p-mission > p { font-family: var(--display); font-size: clamp(22px, 2.4vw, 30px); line-height: 1.3; letter-spacing: -.02em; color: #fff; }
.p-mission > p b { background: var(--grad); -webkit-background-clip: text; background-clip: text; color: transparent; }
.p-mission-g { display: grid; grid-template-columns: 1fr 1fr; gap: 12px; margin-top: 28px; }
.p-mission-g > div { padding: 16px; border-radius: 16px; background: rgba(255, 255, 255, .05); border: 1px solid var(--night-line); }
.p-mission-g b { display: block; color: #fff; margin-top: 12px; }
.p-mission-g span:not(.ico) { font-size: 13.5px; color: var(--night-muted); }
.p-status { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 16px; }
.p-status-i { display: flex; flex-direction: column; padding: 24px; border-radius: var(--r); border: 1px solid var(--line); background: var(--surface); transition: border-color .2s, transform .2s, box-shadow .2s; }
.p-status-i:hover { transform: translateY(-3px); box-shadow: var(--shadow); border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); }
.p-status-i h3 { font-size: 18px; margin: 16px 0 8px; }
.p-status-i p { color: var(--muted); font-size: 14.5px; flex: 1; }
.p-status-i .link { margin-top: 16px; font-size: 14px; }
.p-st { display: inline-flex; align-items: center; gap: 8px; width: fit-content; padding: 4px 11px; border-radius: 999px; font-size: 12px; font-weight: 800; letter-spacing: .02em; }
.p-st.ok { background: rgba(22, 163, 74, .1); color: var(--ok); }
[data-theme="dark"] .p-st.ok { color: #86efac; }
.p-st.soon { background: var(--volt); color: #1a2e05; }
.p-dot { width: 7px; height: 7px; border-radius: 50%; background: currentColor; }
.p-mails { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 16px; }
.p-mail { display: flex; flex-direction: column; gap: 4px; padding: 22px; border-radius: var(--r); border: 1px solid var(--line); background: var(--surface); transition: border-color .2s, box-shadow .2s; min-width: 0; }
.p-mail:hover { border-color: color-mix(in srgb, var(--brand) 40%, var(--line)); box-shadow: var(--shadow-sm); }
.p-mail b { margin-top: 14px; }
.p-mail-e { color: var(--brand-ink); font-weight: 700; overflow-wrap: anywhere; }
.p-mail span:last-child { color: var(--muted); font-size: 14px; }

/* ---------- FAQ ---------- */
.p-faqnav { display: none; position: sticky; top: var(--hdr-h); z-index: 40; background: var(--hdr); backdrop-filter: saturate(1.6) blur(16px); -webkit-backdrop-filter: saturate(1.6) blur(16px); border-bottom: 1px solid var(--line); }
.p-faqnav .wrap { display: flex; gap: 6px; overflow-x: auto; scrollbar-width: none; height: 56px; align-items: center; }
.p-faqnav .wrap::-webkit-scrollbar { display: none; }
.p-faqnav a { flex: none; display: inline-flex; gap: 6px; align-items: center; height: 36px; padding: 0 14px; border-radius: 999px; border: 1px solid var(--line); background: var(--surface); font-size: 14px; font-weight: 600; color: var(--ink-2); }
.p-faq-aside { position: sticky; top: calc(var(--hdr-h) + 24px); display: grid; gap: 16px; }
.p-faq-cats { display: grid; gap: 4px; padding: 8px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); }
.p-faq-cats a { display: flex; gap: 12px; align-items: center; padding: 10px; border-radius: 14px; font-weight: 700; font-size: 15px; transition: background .15s; }
.p-faq-cats a:hover { background: var(--canvas); }
.p-faq-cats .ico { width: 38px; height: 38px; border-radius: 11px; }
.p-faq-cats small { display: block; font-weight: 500; font-size: 12.5px; color: var(--muted); }
.p-help { padding: 22px; border-radius: var(--r-lg); background: var(--night); color: var(--night-muted); font-size: 14.5px; }
.p-help b { display: block; color: #fff; font-size: 17px; margin-bottom: 6px; font-family: var(--display); }
.p-help .btn { margin-top: 16px; }
.p-faq-g { scroll-margin-top: calc(var(--hdr-h) + 72px); }
.p-faq-g + .p-faq-g { margin-top: 56px; }
.p-faq-g h2 { display: flex; gap: 12px; align-items: center; font-size: clamp(22px, 2.4vw, 28px); margin-bottom: 20px; }

/* ---------- Kontak ---------- */
.p-contact { display: grid; grid-template-columns: minmax(0, .85fr) minmax(0, 1.15fr); gap: clamp(28px, 4vw, 48px); align-items: start; }
.p-contact-side { display: grid; gap: 14px; }
.p-route { padding: 10px; border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); display: grid; gap: 2px; }
.p-route > b { padding: 10px 12px 6px; font-family: var(--display); font-size: 17px; }
.p-route a { display: flex; gap: 14px; align-items: flex-start; padding: 12px; border-radius: 14px; transition: background .15s; min-width: 0; }
.p-route a:hover { background: var(--canvas); }
.p-route a > span:last-child { min-width: 0; }
.p-route .ico { width: 40px; height: 40px; border-radius: 12px; }
.p-route b { display: block; font-size: 15px; }
.p-route small { display: block; color: var(--muted); font-size: 13.5px; }
.p-route em { display: block; font-style: normal; color: var(--brand-ink); font-weight: 700; font-size: 14px; margin-top: 2px; overflow-wrap: anywhere; }
.p-hours { display: flex; gap: 14px; align-items: flex-start; padding: 18px 20px; border-radius: var(--r); border: 1px solid var(--line); background: var(--canvas); }
.p-hours .ico { width: 40px; height: 40px; border-radius: 12px; }
.p-hours b { display: block; }
.p-hours span:not(.ico) { color: var(--muted); font-size: 14.5px; }
.p-hours a { color: var(--brand-ink); font-weight: 700; text-decoration: underline; text-underline-offset: 3px; }
.p-form-card { padding: clamp(24px, 4vw, 40px); border-radius: var(--r-lg); border: 1px solid var(--line); background: var(--surface); box-shadow: var(--shadow); }
.p-form-card h2 { font-size: clamp(24px, 2.6vw, 30px); margin-bottom: 6px; }
.p-form-card > p { margin-bottom: 26px; }
.p-hp { position: absolute; left: -9999px; width: 1px; height: 1px; overflow: hidden; }
.p-form-foot { display: flex; justify-content: space-between; align-items: center; gap: 16px; flex-wrap: wrap; }

/* ---------- Responsif ---------- */
@media (max-width: 1080px) {
  .p-duo { height: 620px; }
  .p-trio { grid-template-columns: minmax(0, 1fr); gap: 56px; }
  .p-soon-grid, .p-dl-in, .p-calc, .p-contact { grid-template-columns: minmax(0, 1fr); }
  .p-form-card { order: -1; }
  .p-dl-art { margin-bottom: -170px; }
  .p-status, .p-mails { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .p-kinds { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .p-faq-aside { position: static; }
  .p-faq-cats { display: none; }
  .p-faqnav { display: block; }
}
@media (max-width: 680px) {
  .p-duo { height: 600px; max-width: 360px; }
  .p-duo-back { display: none; }
  .p-duo-front { right: 50%; transform: translateX(50%); }
  .p-duo .p-f1 { left: -2%; top: 120px; }
  .p-duo .p-f2 { right: -2%; bottom: 60px; }
  .p-float { max-width: 210px; padding: 9px 12px; }
  .p-one .p-float { display: none; }
  .p-trio { display: flex; gap: 16px; overflow-x: auto; scroll-snap-type: x mandatory; margin: 0 -16px; padding: 4px 16px 12px; scrollbar-width: none; }
  .p-trio::-webkit-scrollbar { display: none; }
  .p-trio-i { flex: 0 0 82%; scroll-snap-align: center; }
  .p-mini { zoom: .78; }
  .p-soon-art .phone + .phone { display: none; }
  .p-status, .p-mails, .p-kinds, .p-pair, .p-mission-g { grid-template-columns: minmax(0, 1fr); }
  .p-eq { grid-template-columns: minmax(0, 1fr); text-align: center; }
  .p-eq > span { line-height: 1; }
  .p-honest { flex-direction: column; }
  .p-dl { padding-bottom: 48px; }
  .p-dl-art { zoom: .9; margin-bottom: -190px; }
}

/* 40-blog.css */
/* Blog (wilayah Agent C) — awalan bl- (+ .prose untuk isi artikel, .table-wrap dari build) */

/* Kepala halaman blog & artikel */
.bl-hero, .bl-ahead { position: relative; overflow: hidden; isolation: isolate; padding: clamp(36px, 5vw, 64px) 0 clamp(28px, 4vw, 48px); }
.bl-hero-bg { position: absolute; inset: 0; z-index: -1; pointer-events: none; background: radial-gradient(50% 80% at 85% 0%, color-mix(in srgb, var(--c1) 16%, transparent), transparent 70%), radial-gradient(40% 60% at 0% 0%, color-mix(in srgb, var(--c2) 10%, transparent), transparent 70%); }
.bl-hero-bg::after { content: ""; position: absolute; inset: 0; background-image: linear-gradient(color-mix(in srgb, var(--brand) 8%, transparent) 1px, transparent 1px), linear-gradient(90deg, color-mix(in srgb, var(--brand) 8%, transparent) 1px, transparent 1px); background-size: 56px 56px; mask-image: radial-gradient(ellipse 70% 90% at 80% 0%, #000 20%, transparent 70%); -webkit-mask-image: radial-gradient(ellipse 70% 90% at 80% 0%, #000 20%, transparent 70%); }
.bl-hero-in { display: flex; justify-content: space-between; align-items: flex-end; gap: 24px; margin-top: 28px; }
.bl-hero h1 { font-size: clamp(36px, 5.2vw, 64px); letter-spacing: -.04em; line-height: 1.04; max-width: 860px; }
.bl-hero .lead { margin-top: 18px; max-width: 680px; }
.bl-rss { flex: none; display: inline-flex; gap: 8px; align-items: center; height: 40px; padding: 0 16px; border-radius: 999px; border: 1px solid var(--line); background: var(--surface); font-weight: 700; font-size: 14px; color: var(--ink-2); }
.bl-rss:hover { border-color: var(--brand); color: var(--ink); }
.bl-rss .ic { color: #f97316; }
.bl-sec { padding: 8px 0 clamp(56px, 7vw, 96px); }

/* Filter kategori */
.bl-cats { display: flex; gap: 8px; margin-bottom: 32px; overflow-x: auto; scrollbar-width: none; padding: 2px; }
.bl-cats::-webkit-scrollbar { display: none; }
.bl-cats a { flex: none; display: inline-flex; gap: 8px; align-items: center; height: 42px; padding: 0 16px; border-radius: 999px; border: 1px solid var(--line); background: var(--surface); font-weight: 700; font-size: 14.5px; color: var(--ink-2); transition: border-color .15s, background .15s, color .15s; }
.bl-cats a:hover { border-color: var(--brand); color: var(--ink); }
.bl-cats a span { font-size: 12px; font-weight: 800; padding: 1px 7px; border-radius: 999px; background: var(--canvas); color: var(--muted); }
.bl-cats a[aria-current] { background: var(--ink); color: var(--page); border-color: var(--ink); }
.bl-cats a[aria-current] span { background: color-mix(in srgb, var(--page) 18%, transparent); color: var(--page); }
.bl-cats a[aria-current] .ic { color: var(--c1); }

/* Kartu */
.bl-grid { display: grid; grid-template-columns: repeat(3, minmax(0, 1fr)); gap: 24px; }
.bl-card { display: flex; flex-direction: column; border-radius: var(--r-lg); overflow: hidden; border: 1px solid var(--line); background: var(--surface); transition: transform .25s, box-shadow .25s, border-color .25s; }
.bl-card:hover { transform: translateY(-4px); box-shadow: var(--shadow-lg); border-color: color-mix(in srgb, var(--brand) 35%, var(--line)); }
.bl-img { aspect-ratio: 16 / 9; overflow: hidden; background: var(--night); }
.bl-img img { width: 100%; height: 100%; object-fit: cover; transition: transform .6s cubic-bezier(.2, .7, .2, 1); }
.bl-card:hover .bl-img img, .bl-feat:hover .bl-img img { transform: scale(1.04); }
.bl-body { padding: 22px 24px 24px; display: flex; flex-direction: column; gap: 10px; flex: 1; }
.bl-body h3 { font-size: 19.5px; line-height: 1.28; letter-spacing: -.02em; }
.bl-body p { color: var(--muted); font-size: 15px; display: -webkit-box; -webkit-line-clamp: 3; -webkit-box-orient: vertical; overflow: hidden; }
.bl-cat { display: inline-flex; gap: 6px; align-items: center; width: fit-content; font-size: 12px; font-weight: 800; letter-spacing: .08em; text-transform: uppercase; color: var(--brand-ink); }
.bl-meta { display: flex; flex-wrap: wrap; gap: 6px 16px; align-items: center; font-size: 13px; color: var(--muted); margin-top: auto; }
.bl-meta span { display: inline-flex; gap: 6px; align-items: center; }
.bl-feat { display: grid; grid-template-columns: minmax(0, 1.25fr) minmax(0, 1fr); border-radius: var(--r-xl); overflow: hidden; border: 1px solid var(--line); background: var(--surface); margin-bottom: 28px; box-shadow: var(--shadow); transition: box-shadow .25s, border-color .25s; }
.bl-feat:hover { box-shadow: var(--shadow-lg); border-color: color-mix(in srgb, var(--brand) 35%, var(--line)); }
.bl-feat { grid-template-columns: minmax(0, 1.35fr) minmax(0, 1fr); align-items: center; }
.bl-feat .bl-img { aspect-ratio: auto; align-self: stretch; display: flex; align-items: center; min-width: 0; }
.bl-feat .bl-img img { height: auto; aspect-ratio: 16 / 9; }
.bl-feat .bl-body { padding: clamp(28px, 4vw, 48px); justify-content: center; gap: 14px; }
.bl-feat h2 { font-size: clamp(26px, 2.8vw, 36px); letter-spacing: -.035em; line-height: 1.12; }
.bl-feat .bl-meta { margin-top: 4px; }
.bl-feat .link { margin-top: 8px; }
.bl-badge { display: inline-flex; gap: 6px; align-items: center; width: fit-content; padding: 4px 11px; border-radius: 999px; font-size: 12.5px; font-weight: 700; background: var(--soft); color: var(--brand-ink); }
.bl-topics { display: grid; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 16px; }
.bl-topic { display: flex; flex-direction: column; gap: 6px; padding: 22px; border-radius: var(--r); border: 1px solid var(--line); background: var(--canvas); transition: border-color .2s, background .2s; }
.bl-topic:hover { border-color: var(--brand); background: var(--surface); }
.bl-topic b { margin-top: 10px; font-family: var(--display); font-size: 17px; }
.bl-topic span:not(.ico) { color: var(--muted); font-size: 14px; }

/* Artikel */
.bl-ahead .wrap { max-width: 1000px; }
.bl-ahead h1 { font-size: clamp(32px, 4.6vw, 54px); letter-spacing: -.04em; line-height: 1.08; margin: 14px 0 0; }
.bl-ahead .lead { margin-top: 18px; max-width: 780px; }
.bl-cat-lg { margin-top: 28px; padding: 6px 12px; border-radius: 999px; background: var(--soft); letter-spacing: .06em; }
.bl-byline { display: flex; gap: 12px; align-items: center; margin-top: 26px; }
.bl-byline b { font-size: 15px; }
.bl-byline .bl-meta { margin-top: 2px; }
.bl-av { width: 42px; height: 42px; border-radius: 50%; display: grid; place-items: center; background: var(--grad); color: #fff; flex: none; box-shadow: 0 8px 18px -8px rgba(37, 99, 235, .8); }
.bl-cover { margin: 0 auto clamp(36px, 5vw, 64px); max-width: 1200px; border-radius: var(--r-xl); overflow: hidden; aspect-ratio: 16 / 9; background: var(--night); box-shadow: var(--shadow-lg); }
.bl-cover img { width: 100%; height: 100%; object-fit: cover; }
.bl-layout { display: grid; grid-template-columns: 250px minmax(0, 760px); gap: clamp(40px, 5vw, 72px); justify-content: center; align-items: start; }
.bl-main { min-width: 0; }
.bl-side { position: sticky; top: calc(var(--hdr-h) + 28px); display: grid; gap: 24px; }
.bl-toc { display: grid; gap: 2px; }
.bl-toc > b, .bl-share > span { font-size: 12px; font-weight: 800; letter-spacing: .1em; text-transform: uppercase; color: var(--muted); margin-bottom: 8px; }
.bl-toc a, .bl-toc-m a { display: flex; gap: 10px; padding: 8px 10px; border-radius: 10px; color: var(--ink-2); font-size: 14px; line-height: 1.4; transition: color .15s, background .15s; }
.bl-toc a span, .bl-toc-m a span { flex: none; font-family: var(--display); font-size: 12px; font-weight: 700; color: var(--line); padding-top: 1px; transition: color .15s; }
[data-theme="dark"] .bl-toc a span { color: #2a3c56; }
.bl-toc a:hover, .bl-toc a.on { color: var(--ink); background: var(--canvas); }
.bl-toc a.on span, .bl-toc a:hover span { color: var(--brand); }
.bl-toc-m { display: none; margin-bottom: 28px; border: 1px solid var(--line); border-radius: var(--r); background: var(--surface); }
.bl-toc-m summary { list-style: none; cursor: pointer; display: flex; gap: 10px; align-items: center; padding: 14px 16px; font-weight: 700; }
.bl-toc-m summary::-webkit-details-marker { display: none; }
.bl-toc-m summary span { color: var(--muted); font-weight: 500; font-size: 14px; margin-left: auto; }
.bl-toc-m summary .ic:last-child { transition: transform .2s; color: var(--muted); }
.bl-toc-m[open] summary .ic:last-child { transform: rotate(180deg); }
.bl-toc-m nav { padding: 0 8px 10px; display: grid; }
.bl-share { display: flex; gap: 8px; align-items: center; flex-wrap: wrap; margin-top: 40px; padding-top: 24px; border-top: 1px solid var(--line); }
.bl-share > span { margin: 0 6px 0 0; }
.bl-share a, .bl-share button { width: 42px; height: 42px; border-radius: 12px; border: 1px solid var(--line); display: grid; place-items: center; background: var(--surface); color: var(--ink-2); cursor: pointer; transition: border-color .15s, color .15s, transform .15s; }
.bl-share a:hover, .bl-share button:hover { border-color: var(--brand); color: var(--brand-ink); transform: translateY(-2px); }
.bl-share.side { margin: 0; padding: 0; border: 0; }
.bl-share.side > span { width: 100%; margin-bottom: 2px; }
.bl-tags { display: flex; flex-wrap: wrap; gap: 8px; margin-top: 36px; }
.bl-tags span { font-size: 13px; font-weight: 700; padding: 5px 11px; border-radius: 999px; background: var(--canvas); color: var(--muted); border: 1px solid var(--line); }
.bl-cta { display: grid; grid-template-columns: auto minmax(0, 1fr) auto; gap: 18px; align-items: center; margin-top: 36px; padding: 24px; border-radius: var(--r-lg); background: var(--night); color: var(--night-muted); position: relative; overflow: hidden; isolation: isolate; }
.bl-cta::before { content: ""; position: absolute; z-index: -1; width: 300px; height: 300px; right: -80px; top: -150px; border-radius: 50%; background: rgba(0, 212, 255, .2); filter: blur(60px); }
.bl-cta b { display: block; color: #fff; font-family: var(--display); font-size: 18px; letter-spacing: -.01em; }
.bl-cta p { font-size: 14.5px; margin-top: 4px; }
.bl-rel-head { display: flex; justify-content: space-between; align-items: flex-end; gap: 16px; margin-bottom: 36px; flex-wrap: wrap; }
.bl-related { background: var(--canvas); }

/* Prose artikel */
.prose { font-size: 18px; line-height: 1.8; color: var(--ink-2); }
.prose > * + * { margin-top: 1.15em; }
.prose h2 { font-size: clamp(25px, 2.6vw, 31px); color: var(--ink); margin-top: 2.1em; letter-spacing: -.03em; line-height: 1.2; scroll-margin-top: calc(var(--hdr-h) + 24px); }
.prose h2::before { content: ""; display: block; width: 36px; height: 3px; border-radius: 3px; background: var(--grad); margin-bottom: 16px; }
.prose h3 { font-size: 21px; color: var(--ink); margin-top: 1.7em; letter-spacing: -.02em; scroll-margin-top: calc(var(--hdr-h) + 24px); }
.prose > p:first-child { font-size: 1.1em; color: var(--ink); }
.prose a { color: var(--brand-ink); font-weight: 600; text-decoration: underline; text-decoration-thickness: 1.5px; text-underline-offset: 3px; text-decoration-color: color-mix(in srgb, var(--brand) 45%, transparent); }
.prose a:hover { text-decoration-color: currentColor; }
.prose ul, .prose ol { padding-left: 1.4em; }
.prose ul { list-style: disc; }
.prose ol { list-style: decimal; }
.prose li + li { margin-top: .5em; }
.prose li::marker { color: var(--brand); font-weight: 700; }
.prose strong { color: var(--ink); }
.prose blockquote { margin: 1.6em 0; padding: 20px 24px; border-left: 3px solid var(--c1); background: var(--canvas); border-radius: 0 16px 16px 0; color: var(--ink); }
.prose hr { border: 0; height: 1px; background: var(--line); margin: 2.4em 0; }
.prose code { font-family: var(--mono); font-size: .86em; background: var(--canvas); border: 1px solid var(--line); padding: 1px 6px; border-radius: 6px; }
.prose pre { background: #050d1a; color: #d6e4f5; padding: 18px 20px; border-radius: 16px; overflow-x: auto; font-size: 14.5px; line-height: 1.65; border: 1px solid #13233a; }
.prose pre code { background: none; border: 0; padding: 0; font-size: inherit; color: inherit; }
.prose .table-wrap { overflow-x: auto; border: 1px solid var(--line); border-radius: 16px; background: var(--surface); margin: 1.6em 0; }
.prose .table-wrap:focus-visible { outline: 3px solid var(--c1); outline-offset: 2px; }
.prose table { width: 100%; border-collapse: collapse; font-size: 15px; line-height: 1.55; min-width: 560px; }
.prose th, .prose td { padding: 12px 16px; text-align: left; vertical-align: top; border-bottom: 1px solid var(--line-2); }
.prose th { background: var(--canvas); color: var(--ink); font-family: var(--display); font-size: 14.5px; }
.prose tr:last-child td { border-bottom: 0; }

@media (max-width: 1080px) {
  .bl-grid, .bl-topics { grid-template-columns: repeat(2, minmax(0, 1fr)); }
  .bl-feat { grid-template-columns: minmax(0, 1fr); }
  .bl-layout { grid-template-columns: minmax(0, 760px); }
  .bl-side { display: none; }
  .bl-toc-m { display: block; }
}
@media (max-width: 680px) {
  .bl-grid, .bl-topics { grid-template-columns: minmax(0, 1fr); }
  .bl-hero-in { flex-direction: column; align-items: flex-start; }
  .bl-rss { display: none; }
  .bl-cover { border-radius: 20px; margin-left: -4px; margin-right: -4px; }
  .prose { font-size: 17px; line-height: 1.75; }
  .bl-cta { grid-template-columns: minmax(0, 1fr); }
  .bl-cta .btn { justify-self: start; }
  .bl-body { padding: 20px; }
}

/* 90-slider.css */
/* Slider seluler bersama (2026-10-24): grid apa pun yang diberi [data-slider] menjadi slide geser (scroll-snap) di layar ≤ 760px.
   Di layar lebar elemen tetap memakai grid aslinya. Navigasi (.sl-nav: panah + titik) dibuat oleh site.js.
   Varian: data-slider-w="sm" (kartu sempit ±70%, mis. ponsel/mini) · data-slider-w="lg" (±92%, kartu lebar). */
.sl-nav { display: none; }

@media (max-width: 760px) {
  [data-slider] {
    display: flex !important; gap: 14px !important; overflow-x: auto; overscroll-behavior-x: contain;
    scroll-snap-type: x mandatory; scroll-padding-inline: 16px; scrollbar-width: none; -webkit-overflow-scrolling: touch;
    margin-inline: -16px !important; padding: 6px 16px 10px !important; grid-template-columns: none !important;
  }
  [data-slider]::-webkit-scrollbar { display: none; }
  [data-slider] > * {
    flex: 0 0 84% !important; max-width: 84% !important; min-width: 0; scroll-snap-align: start; scroll-snap-stop: always;
    grid-column: auto !important; grid-row: auto !important; margin: 0 !important;
  }
  [data-slider-w="sm"] > * { flex-basis: 72% !important; max-width: 72% !important; }
  [data-slider-w="lg"] > * { flex-basis: 92% !important; max-width: 92% !important; }
  /* Kartu di dalam slide langsung tampil (animasi muncul vertikal tidak relevan saat digeser) */
  [data-slider] > .rv, [data-slider] .rv { opacity: 1 !important; transform: none !important; }
  [data-slider]:focus-visible { outline: 3px solid var(--c1); outline-offset: 4px; border-radius: 18px; }

  .sl-nav { display: flex; align-items: center; justify-content: space-between; gap: 12px; margin-top: 14px; }
  .sl-dots { display: flex; flex-wrap: wrap; gap: 6px; align-items: center; }
  .sl-dot { width: 8px; height: 8px; padding: 0; border: 0; border-radius: 999px; background: var(--line); cursor: pointer; transition: width .25s, background .25s; }
  .sl-dot[aria-current="true"] { width: 22px; background: var(--grad); }
  .sl-btns { display: flex; gap: 8px; }
  .sl-btn { width: 40px; height: 40px; border-radius: 12px; display: grid; place-items: center; border: 1px solid var(--line); background: var(--surface); color: var(--ink); cursor: pointer; }
  .sl-btn:disabled { opacity: .35; cursor: default; }
  .sl-count { font-size: 12.5px; font-weight: 700; color: var(--muted); font-variant-numeric: tabular-nums; margin-right: 4px; }
  .night .sl-dot, .dark .sl-dot { background: rgba(255, 255, 255, .22); }
  .night .sl-btn, .dark .sl-btn { background: rgba(255, 255, 255, .06); border-color: var(--night-line); color: #fff; }
  .night .sl-count { color: var(--night-muted); }
}